The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-2-methyl-4-(2-((R)-4-methyl-3-((2S,3R)-3-methyl-2-((S)-pyrrolidine-2-carboxamido)pentanamido)pentanoyl)thiazole-4-carboxamido)-5-phenylpentanoic acid hydrochloride ID: ALA2021531
PubChem CID: 24822579
Max Phase: Preclinical
Molecular Formula: C33H48ClN5O6S
Molecular Weight: 641.84
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCN1)C(=O)N[C@H](CC(=O)c1nc(C(=O)N[C@@H](Cc2ccccc2)C[C@H](C)C(=O)O)cs1)C(C)C.Cl
Standard InChI: InChI=1S/C33H47N5O6S.ClH/c1-6-20(4)28(38-29(40)24-13-10-14-34-24)31(42)36-25(19(2)3)17-27(39)32-37-26(18-45-32)30(41)35-23(15-21(5)33(43)44)16-22-11-8-7-9-12-22;/h7-9,11-12,18-21,23-25,28,34H,6,10,13-17H2,1-5H3,(H,35,41)(H,36,42)(H,38,40)(H,43,44);1H/t20-,21-,23+,24-,25+,28-;/m0./s1
Standard InChI Key: JXJBTOJZDRYEAA-KMODKYMMSA-N
Molfile:
RDKit 2D
46 47 0 0 0 0 0 0 0 0999 V2000
-3.1527 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4382 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7237 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0093 -0.7661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2948 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4197 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1341 -1.1786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8486 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8486 0.0589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4197 0.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1341 0.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2948 0.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1341 1.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2948 -2.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7237 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0093 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4382 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8671 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1527 -2.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9534 0.0544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7603 0.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1728 -0.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6208 -1.1016 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.0959 0.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8869 1.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6110 1.6470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9465 2.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4616 3.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7670 2.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3504 1.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1473 2.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7306 1.5337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3608 2.9140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6751 3.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0917 4.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3053 5.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1022 5.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6856 4.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4720 4.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3504 1.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5631 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6493 -1.9991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.4563 -2.1706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8688 -1.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3168 -0.8430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8893 2.1804 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
6 5 1 0
6 7 1 6
7 8 1 0
8 9 2 0
6 10 1 0
10 11 1 1
10 12 1 0
11 13 1 0
5 14 2 0
3 15 1 1
15 16 1 0
15 17 1 0
1 18 1 0
1 19 2 0
18 20 2 0
18 23 1 0
20 21 1 0
21 22 2 0
22 23 1 0
21 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 6
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
28 34 1 0
34 35 1 0
34 39 2 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
30 40 1 6
41 8 1 6
41 42 1 0
41 45 1 0
42 43 1 0
43 44 1 0
44 45 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 641.84Molecular Weight (Monoisotopic): 641.3247AlogP: 3.59#Rotatable Bonds: 17Polar Surface Area: 166.59Molecular Species: ZWITTERIONHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.15CX Basic pKa: 9.40CX LogP: 1.53CX LogD: 1.53Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.16Np Likeness Score: -0.07
References 1. Raghavan B, Balasubramanian R, Steele JC, Sackett DL, Fecik RA.. (2008) Cytotoxic simplified tubulysin analogues., 51 (6): [PMID:18314944 ] [10.1021/jm701321p ]