The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,4R)-2-methyl-4-(2-((R)-4-methyl-3-((2S,3R)-3-methyl-2-((S)-1-methylpiperidine-2-carboxamido)pentanamido)pentanoyl)thiazole-4-carboxamido)-5-phenylpentanoic acid hydrochloride ID: ALA2021532
PubChem CID: 24822247
Max Phase: Preclinical
Molecular Formula: C35H52ClN5O6S
Molecular Weight: 669.89
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC[C@H](C)[C@H](NC(=O)[C@@H]1CCCCN1C)C(=O)N[C@H](CC(=O)c1nc(C(=O)N[C@@H](Cc2ccccc2)C[C@H](C)C(=O)O)cs1)C(C)C.Cl
Standard InChI: InChI=1S/C35H51N5O6S.ClH/c1-7-22(4)30(39-32(43)28-15-11-12-16-40(28)6)33(44)37-26(21(2)3)19-29(41)34-38-27(20-47-34)31(42)36-25(17-23(5)35(45)46)18-24-13-9-8-10-14-24;/h8-10,13-14,20-23,25-26,28,30H,7,11-12,15-19H2,1-6H3,(H,36,42)(H,37,44)(H,39,43)(H,45,46);1H/t22-,23-,25+,26+,28-,30-;/m0./s1
Standard InChI Key: UVRFKTWQOCWENS-KSDCZMETSA-N
Molfile:
RDKit 2D
48 49 0 0 0 0 0 0 0 0999 V2000
-3.1527 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4382 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7237 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0093 -0.7661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2948 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4197 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1341 -1.1786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8486 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8486 0.0589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4197 0.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1341 0.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2948 0.4714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1341 1.2964 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2948 -2.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7237 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0093 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4382 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8671 -0.7661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1527 -2.0036 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9534 0.0544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.7603 0.2259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1728 -0.4886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6208 -1.1016 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-5.0959 0.9796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8869 1.3605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6110 1.6470 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.9465 2.4007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4616 3.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7670 2.4869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3504 1.9036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1473 2.1171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7306 1.5337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.3608 2.9140 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6751 3.8650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0917 4.4484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3053 5.2453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1022 5.4588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6856 4.8754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4720 4.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.3504 1.0786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5631 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5631 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2776 -2.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9921 -2.0036 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9921 -1.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2776 -0.7661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2776 0.0589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8893 2.1804 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
6 5 1 0
6 7 1 6
7 8 1 0
8 9 2 0
6 10 1 0
10 11 1 1
10 12 1 0
11 13 1 0
5 14 2 0
3 15 1 1
15 16 1 0
15 17 1 0
1 18 1 0
1 19 2 0
18 20 2 0
18 23 1 0
20 21 1 0
21 22 2 0
22 23 1 0
21 24 1 0
24 25 2 0
24 26 1 0
26 27 1 0
27 28 1 6
27 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
31 33 2 0
28 34 1 0
34 35 1 0
34 39 2 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
30 40 1 6
41 8 1 1
41 42 1 0
46 41 1 0
42 43 1 0
43 44 1 0
44 45 1 0
45 46 1 0
46 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 669.89Molecular Weight (Monoisotopic): 669.3560AlogP: 4.32#Rotatable Bonds: 17Polar Surface Area: 157.80Molecular Species: ACIDHBA: 8HBD: 4#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 4.14CX Basic pKa: 6.39CX LogP: 2.46CX LogD: 1.67Aromatic Rings: 2Heavy Atoms: 47QED Weighted: 0.18Np Likeness Score: -0.14
References 1. Raghavan B, Balasubramanian R, Steele JC, Sackett DL, Fecik RA.. (2008) Cytotoxic simplified tubulysin analogues., 51 (6): [PMID:18314944 ] [10.1021/jm701321p ]