The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(6-chloro-4-(dimethylcarbamoyl)pyridin-2-yl)-2-(7-methyl-1H-indazol-5-yl)ethyl 4-(2-oxo-2,3-dihydro-1H-imidazo[4,5-b]pyridin-1-yl)piperidine-1-carboxylate ID: ALA2023191
PubChem CID: 57404496
Max Phase: Preclinical
Molecular Formula: C30H31ClN8O4
Molecular Weight: 603.08
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1cc(CC(OC(=O)N2CCC(n3c(=O)[nH]c4ncccc43)CC2)c2cc(C(=O)N(C)C)cc(Cl)n2)cc2cn[nH]c12
Standard InChI: InChI=1S/C30H31ClN8O4/c1-17-11-18(12-20-16-33-36-26(17)20)13-24(22-14-19(15-25(31)34-22)28(40)37(2)3)43-30(42)38-9-6-21(7-10-38)39-23-5-4-8-32-27(23)35-29(39)41/h4-5,8,11-12,14-16,21,24H,6-7,9-10,13H2,1-3H3,(H,33,36)(H,32,35,41)
Standard InChI Key: CUCSRSSYJJNZFT-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
16.2154 1.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.2263 1.0287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9471 0.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6574 1.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9212 2.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6397 1.8773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2440 2.4362 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8987 3.1839 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0813 3.0865 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4949 2.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9590 -0.1986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6806 -0.6237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6804 -1.4487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3951 -0.2114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.9654 -1.8567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3937 -1.8548 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.1095 -0.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1093 -1.4491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.8241 -0.2117 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.5333 -0.6278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5360 1.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8173 0.6108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3967 -2.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6785 -3.0915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9683 -2.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1117 -3.0892 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.2547 -3.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5393 -2.6851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.2564 -3.9211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.5428 -4.3351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9717 -4.3321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2486 -0.2166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2502 0.6064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.9659 1.0176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
22.7080 2.1303 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21.9335 1.8466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2481 2.3058 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.2171 1.4813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.7566 0.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.1179 0.0601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.9395 0.0037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.3985 0.6916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.0346 1.4270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9 5 1 0
5 1 1 0
1 10 1 0
19 22 1 0
20 32 1 0
33 21 1 0
21 22 1 0
5 6 2 0
23 24 1 0
3 11 1 0
24 25 2 0
12 11 1 0
23 26 1 0
2 3 1 0
25 27 1 0
12 13 1 0
27 28 2 0
1 2 2 0
27 29 1 0
12 14 1 0
29 30 1 0
3 4 2 0
29 31 1 0
13 15 2 0
15 25 1 0
32 33 1 0
4 6 1 0
33 34 1 0
34 39 1 0
23 16 2 0
16 13 1 0
38 35 1 0
35 36 1 0
36 34 1 0
6 7 1 0
36 37 2 0
14 17 1 0
7 8 2 0
38 39 2 0
17 18 2 0
39 40 1 0
8 9 1 0
40 41 2 0
17 19 1 0
41 42 1 0
19 20 1 0
42 43 2 0
43 38 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.08Molecular Weight (Monoisotopic): 602.2157AlogP: 4.42#Rotatable Bonds: 6Polar Surface Area: 142.10Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 10.68CX Basic pKa: 3.19CX LogP: 3.21CX LogD: 3.21Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.27Np Likeness Score: -1.29
References 1. Luo G, Chen L, Civiello R, Pin SS, Xu C, Kostich W, Kelley M, Conway CM, Macor JE, Dubowchik GM.. (2012) Calcitonin gene-related peptide (CGRP) receptor antagonists: pyridine as a replacement for a core amide group., 22 (8): [PMID:22429470 ] [10.1016/j.bmcl.2012.02.065 ] 2. Luo G, Chen L, Conway CM, Denton R, Keavy D, Gulianello M, Huang Y, Kostich W, Lentz KA, Mercer SE, Schartman R, Signor L, Browning M, Macor JE, Dubowchik GM.. (2012) Discovery of BMS-846372, a Potent and Orally Active Human CGRP Receptor Antagonist for the Treatment of Migraine., 3 (4): [PMID:24900474 ] [10.1021/ml300021s ]