The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID124756640 ID: ALA2028094
Cas Number: 1179480-98-8
PubChem CID: 18580283
Max Phase: Preclinical
Molecular Formula: C22H27ClN6O2
Molecular Weight: 406.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCc1ccc(Nc2nc(Nc3cccc(OC)c3)nc(N3CCOCC3)n2)cc1.Cl
Standard InChI: InChI=1S/C22H26N6O2.ClH/c1-3-16-7-9-17(10-8-16)23-20-25-21(24-18-5-4-6-19(15-18)29-2)27-22(26-20)28-11-13-30-14-12-28;/h4-10,15H,3,11-14H2,1-2H3,(H2,23,24,25,26,27);1H
Standard InChI Key: JPZNCMQARVVZIU-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
4.3827 -3.6850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6695 0.4400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3827 -2.0350 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0972 -0.7975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6682 -0.7975 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3827 0.4400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8116 0.4400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.9538 0.4400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.3827 -1.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0972 0.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6682 0.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5261 0.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9538 1.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6682 -2.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0972 -2.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2406 0.4400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5261 -0.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9551 0.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2393 1.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6682 1.6775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6682 -3.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0972 -3.2725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9538 2.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2406 -1.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9551 -0.7975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2393 2.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6682 2.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9538 3.7400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3840 0.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2393 4.1525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 21 1 0
1 22 1 0
2 18 1 0
2 29 1 0
3 9 1 0
3 14 1 0
3 15 1 0
4 9 2 0
4 10 1 0
5 9 1 0
5 11 2 0
6 10 2 0
6 11 1 0
7 10 1 0
7 12 1 0
8 11 1 0
8 13 1 0
12 16 2 0
12 17 1 0
13 19 2 0
13 20 1 0
14 21 1 0
15 22 1 0
16 18 1 0
17 24 2 0
18 25 2 0
19 26 1 0
20 27 2 0
23 26 2 0
23 27 1 0
23 28 1 0
24 25 1 0
28 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 406.49Molecular Weight (Monoisotopic): 406.2117AlogP: 3.77#Rotatable Bonds: 7Polar Surface Area: 84.43Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.46CX Basic pKa: 5.88CX LogP: 5.46CX LogD: 5.45Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.61Np Likeness Score: -1.55
References 1. PubChem BioAssay data set,