5,6-dimethyl-2-(naphthalen-1-yl)-1H-benzo[d]imidazole

ID: ALA2037265

PubChem CID: 2731163

Max Phase: Preclinical

Molecular Formula: C19H16N2

Molecular Weight: 272.35

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1cc2nc(-c3cccc4ccccc34)[nH]c2cc1C

Standard InChI:  InChI=1S/C19H16N2/c1-12-10-17-18(11-13(12)2)21-19(20-17)16-9-5-7-14-6-3-4-8-15(14)16/h3-11H,1-2H3,(H,20,21)

Standard InChI Key:  JWKZVYBCEOWXSP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 21 24  0  0  0  0  0  0  0  0999 V2000
    0.1884   -0.3353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3003    0.3302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0850    0.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0793   -0.7588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2904   -1.0075    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8031    0.4761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5147    0.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5081   -0.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7908   -1.1774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0099   -0.3269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6604   -0.3163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2380    0.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4147    0.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2520   -1.0348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4313   -1.0365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0242   -1.7469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4367   -2.4561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2605   -2.4504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6639   -1.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2329    0.4643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2204   -1.1845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 10 15  2  0
  1  2  2  0
 14 11  2  0
  2  3  1  0
 11 12  1  0
  3  4  1  0
 12 13  2  0
 13 10  1  0
  1 10  1  0
  4  5  1  0
  1  5  1  0
 14 15  1  0
  6  7  1  0
 15 16  1  0
  7  8  2  0
 16 17  2  0
  8  9  1  0
 17 18  1  0
  4  9  2  0
 18 19  2  0
 19 14  1  0
  3  6  2  0
  7 20  1  0
  8 21  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Yellow fever virus (1530 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 272.35Molecular Weight (Monoisotopic): 272.1313AlogP: 5.00#Rotatable Bonds: 1
Polar Surface Area: 28.68Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 11.87CX Basic pKa: 5.68CX LogP: 5.30CX LogD: 5.29
Aromatic Rings: 4Heavy Atoms: 21QED Weighted: 0.52Np Likeness Score: -0.94

References

1. Vitale G, Corona P, Loriga M, Carta A, Paglietti G, Giliberti G, Sanna G, Farci P, Marongiu ME, La Colla P..  (2012)  5-acetyl-2-arylbenzimidazoles as antiviral agents. Part 4.,  53  [PMID:22513121] [10.1016/j.ejmech.2012.03.038]

Source