5,50-(5-bromo-2,4,6-trimethoxy-1,3-phenylene)bis(methylene)bis(3,4-dibromo-1,2-dimethoxybenzene)

ID: ALA2040866

PubChem CID: 66573254

Max Phase: Preclinical

Molecular Formula: C27H27Br5O7

Molecular Weight: 863.03

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(Cc2c(OC)c(Br)c(OC)c(Cc3cc(OC)c(OC)c(Br)c3Br)c2OC)c(Br)c(Br)c1OC

Standard InChI:  InChI=1S/C27H27Br5O7/c1-33-16-10-12(18(28)20(30)26(16)38-6)8-14-23(35-3)15(25(37-5)22(32)24(14)36-4)9-13-11-17(34-2)27(39-7)21(31)19(13)29/h10-11H,8-9H2,1-7H3

Standard InChI Key:  SSGKSCGDZLLLIZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 39 41  0  0  0  0  0  0  0  0999 V2000
   -3.5683    0.4033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5695   -0.4241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8547   -0.8370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1382   -0.4236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1411    0.4069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8565    0.8161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4282    0.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7122    0.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7124   -0.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0028   -0.8201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7167   -0.4048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7109    0.4244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0049    0.8304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8590    1.6411    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -4.2829    0.8156    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
   -4.2843   -0.8360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9984   -0.4229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8549   -1.6620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5695   -2.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4263   -0.8239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4250   -1.6489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0123    1.6554    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6985    2.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4332   -0.8137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4374   -1.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0055   -1.6451    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    1.4223    0.8421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1398    0.4349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1405   -0.3895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8571   -0.7967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5695   -0.3790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5608    0.4503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8437    0.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8336    1.6787    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    4.2708    0.8705    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    4.2875   -0.7853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9984   -0.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8627   -1.6217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5800   -2.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  1  1  0
  5  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13  8  1  0
  6 14  1  0
  1 15  1  0
  2 16  1  0
 16 17  1  0
  3 18  1  0
 18 19  1  0
  9 20  1  0
 20 21  1  0
 13 22  1  0
 22 23  1  0
 11 24  1  0
 24 25  1  0
 10 26  1  0
 12 27  1  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 33 34  1  0
 32 35  1  0
 31 36  1  0
 36 37  1  0
 30 38  1  0
 38 39  1  0
M  END

Associated Targets(Human)

CA4 Tclin Carbonic anhydrase IV (2163 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CA2 Tclin Carbonic anhydrase II (17698 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CA1 Tclin Carbonic anhydrase I (13240 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
CA6 Tclin Carbonic anhydrase VI (993 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 863.03Molecular Weight (Monoisotopic): 857.7674AlogP: 8.74#Rotatable Bonds: 11
Polar Surface Area: 64.61Molecular Species: NEUTRALHBA: 7HBD:
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 8.90CX LogD: 8.90
Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: 0.42

References

1. Balaydın HT, Şentürk M, Göksu S, Menzek A..  (2012)  Synthesis and carbonic anhydrase inhibitory properties of novel bromophenols and their derivatives including natural products: vidalol B.,  54  [PMID:22687439] [10.1016/j.ejmech.2012.05.025]

Source