The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5,50-(5-bromo-2,4,6-trimethoxy-1,3-phenylene)bis(methylene)bis(3,4-dibromo-1,2-dimethoxybenzene) ID: ALA2040866
PubChem CID: 66573254
Max Phase: Preclinical
Molecular Formula: C27H27Br5O7
Molecular Weight: 863.03
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(Cc2c(OC)c(Br)c(OC)c(Cc3cc(OC)c(OC)c(Br)c3Br)c2OC)c(Br)c(Br)c1OC
Standard InChI: InChI=1S/C27H27Br5O7/c1-33-16-10-12(18(28)20(30)26(16)38-6)8-14-23(35-3)15(25(37-5)22(32)24(14)36-4)9-13-11-17(34-2)27(39-7)21(31)19(13)29/h10-11H,8-9H2,1-7H3
Standard InChI Key: SSGKSCGDZLLLIZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
-3.5683 0.4033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5695 -0.4241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8547 -0.8370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1382 -0.4236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1411 0.4069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8565 0.8161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4282 0.8221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7122 0.4123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7124 -0.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0028 -0.8201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7167 -0.4048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7109 0.4244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0049 0.8304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8590 1.6411 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-4.2829 0.8156 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-4.2843 -0.8360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9984 -0.4229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8549 -1.6620 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.5695 -2.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4263 -0.8239 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4250 -1.6489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0123 1.6554 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6985 2.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4332 -0.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4374 -1.6387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0055 -1.6451 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1.4223 0.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1398 0.4349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1405 -0.3895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 -0.7967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5695 -0.3790 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5608 0.4503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8437 0.8537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8336 1.6787 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
4.2708 0.8705 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
4.2875 -0.7853 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9984 -0.3666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8627 -1.6217 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5800 -2.0293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
6 14 1 0
1 15 1 0
2 16 1 0
16 17 1 0
3 18 1 0
18 19 1 0
9 20 1 0
20 21 1 0
13 22 1 0
22 23 1 0
11 24 1 0
24 25 1 0
10 26 1 0
12 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
33 34 1 0
32 35 1 0
31 36 1 0
36 37 1 0
30 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 863.03Molecular Weight (Monoisotopic): 857.7674AlogP: 8.74#Rotatable Bonds: 11Polar Surface Area: 64.61Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 8.90CX LogD: 8.90Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.19Np Likeness Score: 0.42
References 1. Balaydın HT, Şentürk M, Göksu S, Menzek A.. (2012) Synthesis and carbonic anhydrase inhibitory properties of novel bromophenols and their derivatives including natural products: vidalol B., 54 [PMID:22687439 ] [10.1016/j.ejmech.2012.05.025 ]