The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[(E)-3-(tert-butoxy)-3-oxo-1-propenyl]-5-hydroxymethyl-3-[(Z)-3-isobutyl-5-methylhexylidene]tetrahydro-2-furanone ID: ALA204134
PubChem CID: 11494919
Max Phase: Preclinical
Molecular Formula: C23H38O5
Molecular Weight: 394.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)CC(C/C=C1/CC(/C=C/C(=O)OC(C)(C)C)(CO)OC1=O)CC(C)C
Standard InChI: InChI=1S/C23H38O5/c1-16(2)12-18(13-17(3)4)8-9-19-14-23(15-24,28-21(19)26)11-10-20(25)27-22(5,6)7/h9-11,16-18,24H,8,12-15H2,1-7H3/b11-10+,19-9-
Standard InChI Key: AKVCUOZKJVRCQK-PQONSAHMSA-N
Molfile:
RDKit 2D
28 28 0 0 0 0 0 0 0 0999 V2000
11.0041 0.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8291 0.9750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0859 1.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4166 2.2458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7516 1.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8709 2.0129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1625 2.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0333 1.3542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3231 1.7740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.3133 0.3070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1339 0.3922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6180 -0.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4386 -0.1905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2816 -1.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4610 -1.1143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1246 -1.8676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.9768 -0.4463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7750 0.5628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5956 0.6481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2909 1.2308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3653 2.1377 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7828 2.7219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9949 3.5203 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9829 2.5114 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7913 3.7355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5833 3.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0087 2.9397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5771 4.5344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12 14 1 0
5 7 1 0
14 15 1 0
2 3 1 0
15 16 1 0
5 8 1 0
15 17 1 0
3 4 1 0
13 18 1 0
8 9 1 0
18 19 1 0
4 5 1 0
18 20 1 0
2 10 2 0
7 21 2 0
5 1 1 0
21 22 1 0
10 11 1 0
1 2 1 0
22 23 1 0
22 24 2 0
11 12 1 0
23 25 1 0
3 6 2 0
25 26 1 0
12 13 1 0
25 27 1 0
25 28 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 394.55Molecular Weight (Monoisotopic): 394.2719AlogP: 4.59#Rotatable Bonds: 9Polar Surface Area: 72.83Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.63CX LogD: 5.63Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.46Np Likeness Score: 1.23
References 1. Lee J, Kang JH, Han KC, Kim Y, Kim SY, Youn HS, Mook-Jung I, Kim H, Lo Han JH, Ha HJ, Kim YH, Marquez VE, Lewin NE, Pearce LV, Lundberg DJ, Blumberg PM.. (2006) Branched diacylglycerol-lactones as potent protein kinase C ligands and alpha-secretase activators., 49 (6): [PMID:16539391 ] [10.1021/jm0509391 ]