The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5'-deoxy-5-fluoro-N4-(4-chloro-phenyloxycarbonyl)cytidine-2',3'-carbonate ID: ALA2041691
PubChem CID: 66573771
Max Phase: Preclinical
Molecular Formula: C17H13ClFN3O7
Molecular Weight: 425.76
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H]1O[C@@H](n2cc(F)c(NC(=O)Oc3ccc(Cl)cc3)nc2=O)[C@@H]2OC(=O)O[C@@H]21
Standard InChI: InChI=1S/C17H13ClFN3O7/c1-7-11-12(29-17(25)28-11)14(26-7)22-6-10(19)13(20-15(22)23)21-16(24)27-9-4-2-8(18)3-5-9/h2-7,11-12,14H,1H3,(H,20,21,23,24)/t7-,11-,12-,14-/m1/s1
Standard InChI Key: SSWLKKAKXQEFRI-UBPLGANQSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
8.5672 -10.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5672 -11.7590 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2793 -12.1675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9913 -11.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9913 -10.9340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2793 -10.5174 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7053 -12.1727 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.7071 -10.5236 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4203 -10.9382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1361 -10.5278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4179 -11.7632 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.8494 -10.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8515 -10.5236 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7862 -12.0251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1164 -11.5486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4559 -12.0430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6678 -11.7991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8456 -11.7684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5580 -12.1830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2748 -11.7725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2746 -10.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5614 -10.5324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9886 -12.1862 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7.5469 -12.8122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7228 -12.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4817 -13.6146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1568 -14.0876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8151 -13.5915 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1712 -14.9125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8962 -12.8216 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
8.3713 -12.8091 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
15 16 1 0
16 25 1 0
24 14 1 0
5 8 1 0
16 17 1 1
1 6 1 0
12 18 2 0
8 9 1 0
18 19 1 0
2 3 1 0
19 20 2 0
9 10 1 0
20 21 1 0
3 4 2 0
21 22 2 0
22 12 1 0
9 11 2 0
20 23 1 0
24 25 1 0
4 5 1 0
10 12 1 0
5 6 2 0
1 13 2 0
25 26 1 0
26 27 1 0
27 28 1 0
28 24 1 0
14 2 1 1
27 29 2 0
14 15 1 0
25 30 1 1
4 7 1 0
24 31 1 1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 425.76Molecular Weight (Monoisotopic): 425.0426AlogP: 2.47#Rotatable Bonds: 3Polar Surface Area: 117.98Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.56CX Basic pKa: ┄CX LogP: 2.84CX LogD: 2.81Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.74Np Likeness Score: -0.31
References 1. Jhansi Rani V, Raghavendra A, Kishore P, Nanda Kumar Y, Hema Kumar K, Jagadeeswarareddy K.. (2012) Synthesis and biological activity evaluation of cytidine-5'-deoxy-5-fluoro-N-[(alkoxy/aryloxy)] carbonyl-cyclic 2',3'-carbonates., 54 [PMID:22796042 ] [10.1016/j.ejmech.2012.06.023 ]