The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-N-((R)-1-((7-chloroquinolin-4-yl)amino)-1-oxo-4-phenylbutan-2-yl)-4-methyl-2-((E)-3-(4-nitrophenyl)acrylamido)pentanamide ID: ALA2042189
PubChem CID: 66573659
Max Phase: Preclinical
Molecular Formula: C34H34ClN5O5
Molecular Weight: 628.13
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@@H](NC(=O)/C=C/c1ccc([N+](=O)[O-])cc1)C(=O)N[C@H](CCc1ccccc1)C(=O)Nc1ccnc2cc(Cl)ccc12
Standard InChI: InChI=1S/C34H34ClN5O5/c1-22(2)20-31(37-32(41)17-11-24-8-13-26(14-9-24)40(44)45)34(43)39-29(16-10-23-6-4-3-5-7-23)33(42)38-28-18-19-36-30-21-25(35)12-15-27(28)30/h3-9,11-15,17-19,21-22,29,31H,10,16,20H2,1-2H3,(H,37,41)(H,39,43)(H,36,38,42)/b17-11+/t29-,31-/m1/s1
Standard InChI Key: BXNKGKQCPVSZQB-OTGPHFSISA-N
Molfile:
RDKit 2D
45 48 0 0 0 0 0 0 0 0999 V2000
-1.0717 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 1.0313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 -0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7862 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5006 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 1.8563 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 0.6188 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2151 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2151 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9296 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9296 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3585 -0.6187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3585 -1.4437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0730 -0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5006 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5006 0.6188 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 -0.6187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 -3.0938 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5006 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5006 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 -1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6441 -1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3585 -1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.3585 -2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6441 -3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 -2.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0730 -3.0937 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 6 2 0
1 7 1 0
8 9 1 0
9 10 2 0
8 11 2 0
8 12 1 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
17 18 1 0
13 18 2 0
19 20 2 0
19 21 1 0
16 19 1 0
10 13 1 0
2 12 1 1
4 22 1 0
23 24 1 0
24 25 1 0
25 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
27 32 2 0
26 27 1 0
23 33 2 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
35 44 1 0
39 44 1 0
42 45 1 0
34 38 1 0
23 34 1 0
24 7 1 6
M CHG 2 19 1 21 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 628.13Molecular Weight (Monoisotopic): 627.2248AlogP: 6.10#Rotatable Bonds: 13Polar Surface Area: 143.33Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.97CX Basic pKa: 4.21CX LogP: 6.55CX LogD: 6.55Aromatic Rings: 4Heavy Atoms: 45QED Weighted: 0.09Np Likeness Score: -0.69
References 1. Pérez BC, Teixeira C, Figueiras M, Gut J, Rosenthal PJ, Gomes JR, Gomes P.. (2012) Novel cinnamic acid/4-aminoquinoline conjugates bearing non-proteinogenic amino acids: towards the development of potential dual action antimalarials., 54 [PMID:22683112 ] [10.1016/j.ejmech.2012.05.022 ]