(E)-N-(7-chloroquinolin-4-yl)-3-(4-methoxyphenyl)acrylamide

ID: ALA2042193

PubChem CID: 66573730

Max Phase: Preclinical

Molecular Formula: C19H15ClN2O2

Molecular Weight: 338.79

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(/C=C/C(=O)Nc2ccnc3cc(Cl)ccc23)cc1

Standard InChI:  InChI=1S/C19H15ClN2O2/c1-24-15-6-2-13(3-7-15)4-9-19(23)22-17-10-11-21-18-12-14(20)5-8-16(17)18/h2-12H,1H3,(H,21,22,23)/b9-4+

Standard InChI Key:  KEISDVFEDDSUFN-RUDMXATFSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -0.0110    1.0407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7057    0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4180    1.0483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1346    0.6396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1390   -0.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8557   -0.5941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5635    0.6472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8469    1.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0153    1.8657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7232    0.6244    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7101   -1.8505    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0022   -1.4342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0022   -0.6092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7188   -0.2006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4311   -0.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1478   -0.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8600   -0.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8557   -1.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1390   -1.8581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4267   -1.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5679   -1.8657    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.5679   -0.1778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2824   -1.4153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2824   -0.5903    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6 22  1  0
 22  7  2  0
  7  8  1  0
  4  8  2  0
  1  9  2  0
  1 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 11 20  1  0
 15 20  1  0
 18 21  1  0
 10 14  1  0
 22 24  1  0
 24 23  1  0
M  END

Associated Targets(non-human)

Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 338.79Molecular Weight (Monoisotopic): 338.0822AlogP: 4.55#Rotatable Bonds: 4
Polar Surface Area: 51.22Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.45CX Basic pKa: 4.21CX LogP: 4.17CX LogD: 4.17
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.71Np Likeness Score: -0.97

References

1. Pérez BC, Teixeira C, Figueiras M, Gut J, Rosenthal PJ, Gomes JR, Gomes P..  (2012)  Novel cinnamic acid/4-aminoquinoline conjugates bearing non-proteinogenic amino acids: towards the development of potential dual action antimalarials.,  54  [PMID:22683112] [10.1016/j.ejmech.2012.05.022]

Source