4-(4-(hydroxydiphenylmethyl)piperidin-1-yl)-1-(4-(3-hydroxypropyl)phenyl)butan-1-one

ID: ALA204362

PubChem CID: 44411199

Max Phase: Preclinical

Molecular Formula: C31H37NO3

Molecular Weight: 471.64

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1)c1ccc(CCCO)cc1

Standard InChI:  InChI=1S/C31H37NO3/c33-24-8-9-25-15-17-26(18-16-25)30(34)14-7-21-32-22-19-29(20-23-32)31(35,27-10-3-1-4-11-27)28-12-5-2-6-13-28/h1-6,10-13,15-18,29,33,35H,7-9,14,19-24H2

Standard InChI Key:  IYAIWXMTHZPRGI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -5.3583  -22.5958    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5333  -22.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7083  -22.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5333  -21.7708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5333  -23.4208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8186  -21.3566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8183  -20.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5333  -20.1190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2501  -20.5360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2469  -21.3588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2480  -23.8351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2484  -24.6593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5334  -25.0726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8165  -24.6557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8197  -23.8328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2971  -23.3121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4757  -23.3141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0593  -22.6015    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4706  -21.8852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2982  -21.8815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2343  -22.6046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8245  -23.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0005  -23.3237    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4103  -24.0397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2353  -24.0429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0049  -24.7527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6409  -24.7611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4651  -24.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8812  -24.0511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4669  -23.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6441  -23.3328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7062  -24.0532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1169  -24.7687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9419  -24.7707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3527  -25.4862    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  2  5  1  0
  9 10  2  0
  3 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 10  4  1  0
 18 21  1  0
  2  3  1  0
 21 22  1  0
  5 11  2  0
 22 23  1  0
  4  6  2  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
  1  2  1  0
 24 26  2  0
 12 13  2  0
 25 27  2  0
  6  7  1  0
 27 28  1  0
 13 14  1  0
 28 29  2  0
  2  4  1  0
 29 30  1  0
 14 15  2  0
 30 31  2  0
 31 25  1  0
 15  5  1  0
 29 32  1  0
  3 16  1  0
 32 33  1  0
  7  8  2  0
 33 34  1  0
 34 35  1  0
M  END

Associated Targets(Human)

CYP2J2 Tchem Cytochrome P450 2J2 (258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 471.64Molecular Weight (Monoisotopic): 471.2773AlogP: 5.22#Rotatable Bonds: 11
Polar Surface Area: 60.77Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.22CX Basic pKa: 8.41CX LogP: 4.99CX LogD: 3.94
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.37

References

1. Lafite P, Dijols S, Buisson D, Macherey AC, Zeldin DC, Dansette PM, Mansuy D..  (2006)  Design and synthesis of selective, high-affinity inhibitors of human cytochrome P450 2J2.,  16  (10): [PMID:16495056] [10.1016/j.bmcl.2006.02.004]

Source