decyl 6-(decylamino)-6-oxohexyl carbonate

ID: ALA204373

PubChem CID: 44410259

Max Phase: Preclinical

Molecular Formula: C27H53NO4

Molecular Weight: 455.72

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCCCCCCCCNC(=O)CCCCCOC(=O)OCCCCCCCCCC

Standard InChI:  InChI=1S/C27H53NO4/c1-3-5-7-9-11-13-15-19-23-28-26(29)22-18-17-21-25-32-27(30)31-24-20-16-14-12-10-8-6-4-2/h3-25H2,1-2H3,(H,28,29)

Standard InChI Key:  BHBRWHQBCNWIIU-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 31  0  0  0  0  0  0  0  0999 V2000
   -1.2985   -2.5010    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5826   -2.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3027   -3.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0207   -3.7374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5888   -3.7446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1211   -3.3277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8350   -3.7369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5490   -3.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2630   -3.7327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9770   -3.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6909   -3.7285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4049   -3.3152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1189   -3.7244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1295   -2.4969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8434   -2.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5574   -2.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2714   -2.0751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2672   -1.2484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5490   -0.8350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9819   -0.8328    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6951   -1.2401    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4091   -0.8267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1231   -1.2359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8371   -0.8225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5510   -1.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2650   -0.8184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9790   -1.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6930   -0.8142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4070   -1.2233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1209   -0.8100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8329   -3.3068    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5468   -3.7202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  8  9  1  0
 17 18  1  0
  3  5  1  0
 18 19  2  0
  9 10  1  0
 18 20  1  0
  1  3  1  0
 20 21  1  0
 10 11  1  0
 21 22  1  0
  5  6  1  0
 22 23  1  0
 11 12  1  0
 23 24  1  0
  1  2  1  0
 24 25  1  0
 12 13  1  0
 25 26  1  0
  6  7  1  0
 26 27  1  0
  2 14  1  0
 27 28  1  0
  3  4  2  0
 28 29  1  0
 14 15  1  0
 29 30  1  0
  7  8  1  0
 13 31  1  0
 15 16  1  0
 31 32  1  0
M  END

Alternative Forms

Associated Targets(non-human)

Sus scrofa (849 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 455.72Molecular Weight (Monoisotopic): 455.3975AlogP: 8.10#Rotatable Bonds: 24
Polar Surface Area: 64.63Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 8.83CX LogD: 8.83
Aromatic Rings: Heavy Atoms: 32QED Weighted: 0.12Np Likeness Score: -0.16

References

1. Klimentová J, Hrabálek A, Vávrová K, Holas T, Kroutil A..  (2006)  Synthesis and transdermal penetration-enhancing activity of carbonic and carbamic acid esters--comparison with transkarbam 12.,  16  (7): [PMID:16446088] [10.1016/j.bmcl.2005.12.086]

Source