himeic acid A

ID: ALA2046773

PubChem CID: 11774903

Max Phase: Preclinical

Molecular Formula: C22H29NO8

Molecular Weight: 435.47

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Himeic Acid A | Himeic Acid A|(E)-11-[5-[[(3S)-3-carboxybutanoyl]carbamoyl]-4-oxopyran-2-yl]undec-10-enoic acid|Himeic acid A_120102|CHEMBL2046773|SCHEMBL23760360|CHEBI:214481

Canonical SMILES:  C[C@@H](CC(=O)NC(=O)c1coc(/C=C/CCCCCCCCC(=O)O)cc1=O)C(=O)O

Standard InChI:  InChI=1S/C22H29NO8/c1-15(22(29)30)12-19(25)23-21(28)17-14-31-16(13-18(17)24)10-8-6-4-2-3-5-7-9-11-20(26)27/h8,10,13-15H,2-7,9,11-12H2,1H3,(H,26,27)(H,29,30)(H,23,25,28)/b10-8+/t15-/m0/s1

Standard InChI Key:  OKGLROPOZIVCCZ-HQPKTYMTSA-N

Molfile:  

     RDKit          2D

 31 31  0  0  0  0  0  0  0  0999 V2000
   -0.8500  -11.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8500  -11.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1380  -12.2333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5740  -11.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5740  -11.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1380  -10.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1380   -9.7583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5657  -10.5896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5681   -9.7646    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2789  -11.0042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2838   -9.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2862   -8.5292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9970   -9.7688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7127   -9.3584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4260   -9.7730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1433   -9.3611    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4252  -10.5965    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7151   -8.5334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2879  -12.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2867  -13.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0006  -13.4771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9994  -14.3021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7133  -14.7156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7121  -15.5406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4259  -15.9541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4247  -16.7791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1386  -17.1927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1374  -18.0177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8513  -18.4312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8511  -19.2575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5674  -18.0210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  8  1  0
 15 16  1  0
 15 17  2  0
  1  6  1  0
 14 18  1  1
  8  9  1  0
  4 19  1  0
  2  3  1  0
 19 20  2  0
  8 10  2  0
 20 21  1  0
  3  4  1  0
 21 22  1  0
  9 11  1  0
 22 23  1  0
  4  5  2  0
 23 24  1  0
 11 12  2  0
 24 25  1  0
  5  6  1  0
 25 26  1  0
 11 13  1  0
 26 27  1  0
 27 28  1  0
 13 14  1  0
 28 29  1  0
  6  7  2  0
 14 15  1  0
 29 30  1  0
 29 31  2  0
M  END

Alternative Forms

  1. Parent:

    ALA2046773

    HIMEIC ACID A

Associated Targets(Human)

UBA1 Tbio Ubiquitin-like modifier-activating enzyme 1 (57 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 435.47Molecular Weight (Monoisotopic): 435.1893AlogP: 3.23#Rotatable Bonds: 14
Polar Surface Area: 150.98Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 3.80CX Basic pKa: CX LogP: 2.93CX LogD: -2.67
Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.38Np Likeness Score: 0.97

References

1. Yamanokuchi R, Imada K, Miyazaki M, Kato H, Watanabe T, Fujimuro M, Saeki Y, Yoshinaga S, Terasawa H, Iwasaki N, Rotinsulu H, Losung F, Mangindaan RE, Namikoshi M, de Voogd NJ, Yokosawa H, Tsukamoto S..  (2012)  Hyrtioreticulins A-E, indole alkaloids inhibiting the ubiquitin-activating enzyme, from the marine sponge Hyrtios reticulatus.,  20  (14): [PMID:22695182] [10.1016/j.bmc.2012.05.044]
2. da Silva SR, Paiva SL, Lukkarila JL, Gunning PT..  (2013)  Exploring a new frontier in cancer treatment: targeting the ubiquitin and ubiquitin-like activating enzymes.,  56  (6): [PMID:23360215] [10.1021/jm301420b]

Source