The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Dimethyl 4-(3-(3-(3-(4-(3-methoxyphenyl)piperidin-1-yl)propyl)ureido)phenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate ID: ALA2046866
Max Phase: Preclinical
Molecular Formula: C33H42N4O6
Molecular Weight: 590.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(NC(=O)NCCCN2CCC(c3cccc(OC)c3)CC2)c1
Standard InChI: InChI=1S/C33H42N4O6/c1-21-28(31(38)42-4)30(29(22(2)35-21)32(39)43-5)25-10-6-11-26(19-25)36-33(40)34-15-8-16-37-17-13-23(14-18-37)24-9-7-12-27(20-24)41-3/h6-7,9-12,19-20,23,30,35H,8,13-18H2,1-5H3,(H2,34,36,40)
Standard InChI Key: WMYSXJSJXZFODY-UHFFFAOYSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
8.9027 -14.5166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9016 -15.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6164 -15.7569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3328 -15.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3300 -14.5130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6146 -14.1039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6181 -16.5797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9019 -16.9914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9013 -17.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6162 -18.2291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3332 -17.8124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3302 -16.9895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0429 -14.0978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7589 -14.5076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4718 -14.0924 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7620 -15.3326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.1878 -14.5022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9008 -14.0870 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6168 -14.4968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3297 -14.0817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.0429 -14.4928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7537 -14.0811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7549 -13.2558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0390 -12.8438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3220 -13.2571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4659 -12.8460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1806 -13.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8946 -12.8484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.8951 -12.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.1756 -11.6102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.4645 -12.0244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6089 -13.2613 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.6085 -14.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0436 -16.5752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0416 -15.7502 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7591 -16.9859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.4726 -16.5716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0490 -18.2225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1865 -18.2276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1879 -16.5780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1890 -15.7530 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.4729 -16.9896 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7590 -16.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
10 11 1 0
5 6 2 0
11 12 2 0
12 7 1 0
20 25 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
3 7 1 0
6 1 1 0
26 27 2 0
5 13 1 0
27 28 1 0
1 2 2 0
28 29 2 0
13 14 1 0
29 30 1 0
3 4 2 0
30 31 2 0
31 26 1 0
23 26 1 0
14 15 1 0
28 32 1 0
7 8 1 0
32 33 1 0
14 16 2 0
12 34 1 0
34 35 2 0
15 17 1 0
34 36 1 0
8 9 2 0
36 37 1 0
17 18 1 0
11 38 1 0
4 5 1 0
9 39 1 0
18 19 1 0
8 40 1 0
9 10 1 0
40 41 2 0
19 20 1 0
40 42 1 0
20 21 1 0
42 43 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 590.72Molecular Weight (Monoisotopic): 590.3104AlogP: 4.67#Rotatable Bonds: 10Polar Surface Area: 118.23Molecular Species: BASEHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.51CX Basic pKa: 8.98CX LogP: 3.20CX LogD: 1.61Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.27Np Likeness Score: -1.06
References 1. Ronchetti R, Moroni G, Carotti A, Gioiello A, Camaioni E.. (2021) Recent advances in urea- and thiourea-containing compounds: focus on innovative approaches in medicinal chemistry and organic synthesis., 12 (7.0): [PMID:34355177 ] [10.1039/D1MD00058F ]