The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-3-(3-Bromo-4-hydroxyphenyl)-N-(3-(2-((E)-3-(3-bromo-4-hydroxyphenyl)-2-(hydroxyimino)propanamido)ethylthio)-propyl)-2-(hydroxyimino)propanamide ID: ALA2047705
PubChem CID: 57326508
Max Phase: Preclinical
Molecular Formula: C23H26Br2N4O6S
Molecular Weight: 646.36
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(NCCCSCCNC(=O)/C(Cc1ccc(O)c(Br)c1)=N/O)/C(Cc1ccc(O)c(Br)c1)=N/O
Standard InChI: InChI=1S/C23H26Br2N4O6S/c24-16-10-14(2-4-20(16)30)12-18(28-34)22(32)26-6-1-8-36-9-7-27-23(33)19(29-35)13-15-3-5-21(31)17(25)11-15/h2-5,10-11,30-31,34-35H,1,6-9,12-13H2,(H,26,32)(H,27,33)/b28-18+,29-19+
Standard InChI Key: BDYSKDIFUSBAPW-UOSOPFLXSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
1.7862 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5006 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2151 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7862 0.6187 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0717 1.8562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5006 2.6813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2151 3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3572 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0717 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 1.8562 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.5006 1.4437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6441 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6441 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 1.4437 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.3585 0.6187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.0730 0.2062 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9296 -1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 -2.2688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5006 -1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5006 -1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7862 -2.2687 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2151 -3.0938 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.9296 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 1.4438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3585 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3585 2.6813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6441 3.0938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9296 2.6812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0730 3.0938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.0730 1.4438 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
1 4 2 0
1 5 1 0
6 7 1 0
2 6 2 0
8 9 1 0
9 10 1 0
12 13 1 0
11 12 1 0
14 15 1 0
15 16 1 0
14 17 2 0
14 18 1 0
19 20 1 0
15 19 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 26 1 0
21 26 2 0
24 27 1 0
23 28 1 0
16 21 1 0
13 18 1 0
10 11 1 0
5 8 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 2 0
32 35 1 0
31 36 1 0
3 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 646.36Molecular Weight (Monoisotopic): 643.9940AlogP: 3.42#Rotatable Bonds: 13Polar Surface Area: 163.84Molecular Species: NEUTRALHBA: 9HBD: 6#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: 7.71CX Basic pKa: ┄CX LogP: 4.16CX LogD: 3.97Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.08Np Likeness Score: -0.03
References 1. Baud MG, Leiser T, Haus P, Samlal S, Wong AC, Wood RJ, Petrucci V, Gunaratnam M, Hughes SM, Buluwela L, Turlais F, Neidle S, Meyer-Almes FJ, White AJ, Fuchter MJ.. (2012) Defining the mechanism of action and enzymatic selectivity of psammaplin A against its epigenetic targets., 55 (4): [PMID:22280363 ] [10.1021/jm2016182 ]