The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E,2'E)-N,N'-(2,2'-Disulfanediylbis(ethane-2,1-diyl))bis(2-(hydroxyimino)-3-(4-(methylthio)phenyl)propanamide) ID: ALA2047707
PubChem CID: 57326323
Max Phase: Preclinical
Molecular Formula: C24H30N4O4S4
Molecular Weight: 566.80
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CSc1ccc(C/C(=N\O)C(=O)NCCSSCCNC(=O)/C(Cc2ccc(SC)cc2)=N/O)cc1
Standard InChI: InChI=1S/C24H30N4O4S4/c1-33-19-7-3-17(4-8-19)15-21(27-31)23(29)25-11-13-35-36-14-12-26-24(30)22(28-32)16-18-5-9-20(34-2)10-6-18/h3-10,31-32H,11-16H2,1-2H3,(H,25,29)(H,26,30)/b27-21+,28-22+
Standard InChI Key: CDGYDTXJJZKBJS-GPAWKIAZSA-N
Molfile:
RDKit 2D
36 37 0 0 0 0 0 0 0 0999 V2000
11.6681 -2.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6693 -1.4971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9544 -1.0842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2380 -1.4976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2409 -2.3281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9562 -2.7372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5229 -1.0862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8091 -1.4998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0939 -1.0884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8104 -2.3248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.5255 -2.7362 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0926 -0.2634 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3801 -1.5021 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6650 -1.0907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9512 -1.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2361 -1.0929 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.9098 -0.2749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9110 -1.1023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1961 -1.5152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4797 -1.1018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4826 -0.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1979 0.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2354 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9492 -1.0996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6644 -1.5110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9479 -0.2746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2328 0.1368 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6657 -2.3360 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3782 -1.0973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0933 -1.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8071 -1.0951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5222 -1.5065 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.3827 -2.7368 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
13.0972 -2.3243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6244 0.1374 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.6244 0.9624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 33 1 0
8 9 1 0
4 5 1 0
8 10 2 0
2 3 1 0
10 11 1 0
5 6 2 0
9 12 2 0
6 1 1 0
9 13 1 0
1 2 2 0
13 14 1 0
4 7 1 0
14 15 1 0
3 4 2 0
15 16 1 0
7 8 1 0
24 25 1 0
20 21 1 0
24 26 2 0
18 19 1 0
26 27 1 0
21 22 2 0
25 28 2 0
22 17 1 0
25 29 1 0
17 18 2 0
29 30 1 0
20 23 1 0
30 31 1 0
19 20 2 0
31 32 1 0
23 24 1 0
17 35 1 0
32 16 1 0
33 34 1 0
35 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 566.80Molecular Weight (Monoisotopic): 566.1150AlogP: 4.19#Rotatable Bonds: 15Polar Surface Area: 123.38Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.84CX Basic pKa: ┄CX LogP: 4.41CX LogD: 4.39Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.06Np Likeness Score: -0.07
References 1. Baud MG, Leiser T, Haus P, Samlal S, Wong AC, Wood RJ, Petrucci V, Gunaratnam M, Hughes SM, Buluwela L, Turlais F, Neidle S, Meyer-Almes FJ, White AJ, Fuchter MJ.. (2012) Defining the mechanism of action and enzymatic selectivity of psammaplin A against its epigenetic targets., 55 (4): [PMID:22280363 ] [10.1021/jm2016182 ]