The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2E,2'E)-N,N'-(2,2'-disulfanediylbis(ethane-2,1-diyl))bis(3-(3-bromo-4-(dimethylamino)phenyl)-2-(hydroxyimino)propanamide) ID: ALA2047716
PubChem CID: 51033008
Max Phase: Preclinical
Molecular Formula: C26H34Br2N6O4S2
Molecular Weight: 718.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)c1ccc(C/C(=N\O)C(=O)NCCSSCCNC(=O)/C(Cc2ccc(N(C)C)c(Br)c2)=N/O)cc1Br
Standard InChI: InChI=1S/C26H34Br2N6O4S2/c1-33(2)23-7-5-17(13-19(23)27)15-21(31-37)25(35)29-9-11-39-40-12-10-30-26(36)22(32-38)16-18-6-8-24(34(3)4)20(28)14-18/h5-8,13-14,37-38H,9-12,15-16H2,1-4H3,(H,29,35)(H,30,36)/b31-21+,32-22+
Standard InChI Key: ATKVQHJIKKIMAT-RWRHWQIFSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
10.8264 -2.3495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8276 -1.5221 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1127 -1.1092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3963 -1.5226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3992 -2.3531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1145 -2.7622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6812 -1.1112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9674 -1.5248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2522 -1.1134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9687 -2.3498 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.6838 -2.7612 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.2509 -0.2884 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5384 -1.5271 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.8233 -1.1157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1095 -1.5293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3944 -1.1179 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-2.7514 -0.2999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7526 -1.1273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0377 -1.5402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3213 -1.1268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3242 -0.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0395 0.1128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6062 -1.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1076 -1.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8228 -1.5360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1063 -0.2996 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.6088 0.1118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8241 -2.3610 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5366 -1.1223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2517 -1.5337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9655 -1.1201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6806 -1.5315 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.4660 0.1125 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4661 0.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1804 -0.3002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5409 -2.7619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5411 -3.5869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2553 -2.3493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0419 0.9378 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
11.5424 -1.1102 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
9 12 2 0
6 1 1 0
9 13 1 0
1 2 2 0
13 14 1 0
4 7 1 0
14 15 1 0
3 4 2 0
15 16 1 0
24 25 1 0
20 21 1 0
24 26 2 0
18 19 1 0
26 27 1 0
21 22 2 0
25 28 2 0
22 17 1 0
25 29 1 0
17 18 2 0
29 30 1 0
20 23 1 0
30 31 1 0
19 20 2 0
31 32 1 0
23 24 1 0
32 16 1 0
7 8 1 0
17 33 1 0
33 34 1 0
8 9 1 0
33 35 1 0
4 5 1 0
1 36 1 0
8 10 2 0
36 37 1 0
2 3 1 0
36 38 1 0
10 11 1 0
22 39 1 0
5 6 2 0
2 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 718.54Molecular Weight (Monoisotopic): 716.0450AlogP: 4.40#Rotatable Bonds: 15Polar Surface Area: 129.86Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.60CX Basic pKa: 2.14CX LogP: 4.90CX LogD: 4.88Aromatic Rings: 2Heavy Atoms: 40QED Weighted: 0.07Np Likeness Score: -0.09
References 1. Baud MG, Leiser T, Haus P, Samlal S, Wong AC, Wood RJ, Petrucci V, Gunaratnam M, Hughes SM, Buluwela L, Turlais F, Neidle S, Meyer-Almes FJ, White AJ, Fuchter MJ.. (2012) Defining the mechanism of action and enzymatic selectivity of psammaplin A against its epigenetic targets., 55 (4): [PMID:22280363 ] [10.1021/jm2016182 ]