The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-(2-(benzofuran-6-carbonyl)-5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carboxamido)-3-(2-chloro-3-(methylsulfonyl)phenyl)propanoic acid ID: ALA2048029
PubChem CID: 62705406
Max Phase: Preclinical
Molecular Formula: C29H23Cl3N2O7S
Molecular Weight: 649.94
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CS(=O)(=O)c1cccc(C[C@H](NC(=O)c2c(Cl)cc3c(c2Cl)CCN(C(=O)c2ccc4ccoc4c2)C3)C(=O)O)c1Cl
Standard InChI: InChI=1S/C29H23Cl3N2O7S/c1-42(39,40)23-4-2-3-16(25(23)31)12-21(29(37)38)33-27(35)24-20(30)11-18-14-34(9-7-19(18)26(24)32)28(36)17-6-5-15-8-10-41-22(15)13-17/h2-6,8,10-11,13,21H,7,9,12,14H2,1H3,(H,33,35)(H,37,38)/t21-/m0/s1
Standard InChI Key: GMUWOYDXNLWCCN-NRFANRHFSA-N
Molfile:
RDKit 2D
42 46 0 0 0 0 0 0 0 0999 V2000
4.1175 2.3870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9174 2.5995 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.3334 3.1861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6383 -2.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3547 -1.9479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3518 -1.1173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6365 -0.7082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0765 -1.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0769 -1.1209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7896 -0.7099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5066 -1.1216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5062 -1.9491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7888 -2.3646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2207 -2.3611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9350 -1.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2212 -3.1861 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.9306 -1.1246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6439 -0.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6433 -2.3622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6345 0.1167 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.0697 -2.3591 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.0646 -0.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7806 -1.1120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0615 0.1227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4934 -0.6968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4959 0.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2095 -1.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2126 -1.9316 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9223 -0.6914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2117 0.5396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9215 0.1207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6368 0.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6397 1.3562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9214 1.7707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2093 1.3586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3574 -1.9533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3629 -1.1211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1559 -0.8692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6397 -1.5457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1470 -2.2155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6353 3.0085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4940 1.7698 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
8 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 9 1 0
8 9 2 0
8 13 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
12 14 1 0
14 15 1 0
14 16 2 0
15 17 2 0
17 18 1 0
18 37 2 0
36 19 2 0
19 15 1 0
7 20 1 0
5 21 1 0
6 22 1 0
22 23 1 0
22 24 2 0
23 25 1 0
25 26 1 1
25 27 1 0
27 28 1 0
27 29 2 0
26 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 36 1 0
34 2 1 0
2 41 1 0
35 42 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 649.94Molecular Weight (Monoisotopic): 648.0292AlogP: 5.42#Rotatable Bonds: 7Polar Surface Area: 133.99Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.22CX Basic pKa: ┄CX LogP: 4.62CX LogD: 1.18Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.27Np Likeness Score: -0.64
References 1. Zhong M, Gadek TR, Bui M, Shen W, Burnier J, Barr KJ, Hanan EJ, Oslob JD, Yu CH, Zhu J, Arkin MR, Evanchik MJ, Flanagan WM, Hoch U, Hyde J, Prabhu S, Silverman JA, Wright J.. (2012) Discovery and Development of Potent LFA-1/ICAM-1 Antagonist SAR 1118 as an Ophthalmic Solution for Treating Dry Eye., 3 (3): [PMID:24900456 ] [10.1021/ml2002482 ]