The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(20R)-25-Bromo-27-norcholest-5-en-3beta-ol ID: ALA2048323
PubChem CID: 70686268
Max Phase: Preclinical
Molecular Formula: C26H43BrO
Molecular Weight: 451.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(Br)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C26H43BrO/c1-17(6-5-7-18(2)27)22-10-11-23-21-9-8-19-16-20(28)12-14-25(19,3)24(21)13-15-26(22,23)4/h8,17-18,20-24,28H,5-7,9-16H2,1-4H3/t17-,18?,20+,21+,22-,23+,24+,25+,26-/m1/s1
Standard InChI Key: LTFMGHWBBACKDO-JVMDNGGPSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
21.2167 -18.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0792 -19.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0792 -20.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2167 -19.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7917 -19.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5042 -19.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0042 -18.3917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7917 -21.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5042 -18.2333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5042 -20.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7917 -18.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0042 -19.7208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3667 -19.4708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4917 -19.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3667 -21.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.4417 -17.6833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2167 -17.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6542 -19.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.6542 -20.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0792 -19.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9292 -21.1208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
23.6542 -16.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
23.2667 -17.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22.0042 -16.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.4792 -16.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
24.8792 -16.1958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
25.7042 -16.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5042 -19.0583 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
21.2167 -20.2958 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
22.8292 -18.3917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
19.7917 -20.2958 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
24.4490 -15.4918 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 2 1 0
4 1 1 0
5 11 1 0
6 4 1 0
7 1 1 0
8 10 1 0
9 1 1 0
10 6 1 0
11 9 1 0
12 4 1 0
13 2 1 0
14 7 1 0
15 3 1 0
16 7 1 0
1 17 1 1
18 13 1 0
19 18 1 0
2 20 1 1
19 21 1 1
22 23 1 0
23 16 1 0
16 24 1 6
25 22 1 0
26 25 1 0
27 26 1 0
6 28 1 1
4 29 1 6
7 30 1 6
5 31 1 6
12 14 1 0
6 5 1 0
3 8 2 0
15 19 1 0
26 32 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 451.53Molecular Weight (Monoisotopic): 450.2497AlogP: 7.52#Rotatable Bonds: 5Polar Surface Area: 20.23Molecular Species: NEUTRALHBA: 1HBD: 1#RO5 Violations: 1HBA (Lipinski): 1HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.90CX LogD: 6.90Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.34Np Likeness Score: 2.53
References 1. Johnston JB, Singh AA, Clary AA, Chen CK, Hayes PY, Chow S, De Voss JJ, Ortiz de Montellano PR.. (2012) Substrate analog studies of the ω-regiospecificity of Mycobacterium tuberculosis cholesterol metabolizing cytochrome P450 enzymes CYP124A1, CYP125A1 and CYP142A1., 20 (13): [PMID:22647881 ] [10.1016/j.bmc.2012.05.003 ]