The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
25-thia-27-norcholest-4-en-3-one ID: ALA2048327
PubChem CID: 70688385
Max Phase: Preclinical
Molecular Formula: C25H40OS
Molecular Weight: 388.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CSCCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C
Standard InChI: InChI=1S/C25H40OS/c1-17(6-5-15-27-4)21-9-10-22-20-8-7-18-16-19(26)11-13-24(18,2)23(20)12-14-25(21,22)3/h16-17,20-23H,5-15H2,1-4H3/t17-,20+,21-,22+,23+,24+,25-/m1/s1
Standard InChI Key: KQWZVOYEUWXTLN-XBCZOFBYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
7.9167 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7792 -1.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7792 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2042 -1.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7042 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2042 0.5708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2042 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 0.1583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7042 -0.9167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -0.6667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1917 -0.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0667 -2.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1417 1.1208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 0.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 -1.0792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3542 -1.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7792 -0.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6292 -2.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3542 1.8625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9667 1.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7042 1.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1792 1.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5792 2.6083 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
12.4042 2.6333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2042 -0.2542 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.9167 -1.4917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.5292 0.4125 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
6.4917 -1.4917 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 5 1 0
3 2 1 0
4 1 1 0
5 11 1 0
6 4 1 0
7 1 1 0
8 10 1 0
9 1 1 0
10 6 1 0
11 9 1 0
12 4 1 0
13 2 1 0
14 7 1 0
15 3 2 0
16 7 1 0
1 17 1 1
18 13 1 0
19 18 1 0
2 20 1 1
19 21 2 0
22 23 1 0
23 16 1 0
16 24 1 6
25 22 1 0
26 25 1 0
27 26 1 0
6 28 1 1
4 29 1 6
7 30 1 6
5 31 1 6
12 14 1 0
6 5 1 0
3 8 1 0
15 19 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 388.66Molecular Weight (Monoisotopic): 388.2800AlogP: 6.91#Rotatable Bonds: 5Polar Surface Area: 17.07Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 1HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.71CX LogD: 6.71Aromatic Rings: ┄Heavy Atoms: 27QED Weighted: 0.48Np Likeness Score: 2.08
References 1. Johnston JB, Singh AA, Clary AA, Chen CK, Hayes PY, Chow S, De Voss JJ, Ortiz de Montellano PR.. (2012) Substrate analog studies of the ω-regiospecificity of Mycobacterium tuberculosis cholesterol metabolizing cytochrome P450 enzymes CYP124A1, CYP125A1 and CYP142A1., 20 (13): [PMID:22647881 ] [10.1016/j.bmc.2012.05.003 ]