1-{2-[(4R,6S)-8-Chloro-6-(2,3-dimethoxyphenyl)-4H,6H-pyrrolo[1,2-a][4,1]benzoxazepin-4-yl]ethyl}-1H-pyrazole-4-carboxylic acid

ID: ALA2057956

PubChem CID: 57777809

Max Phase: Preclinical

Molecular Formula: C26H24ClN3O5

Molecular Weight: 493.95

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc([C@H]2O[C@H](CCn3cc(C(=O)O)cn3)c3cccn3-c3ccc(Cl)cc32)c1OC

Standard InChI:  InChI=1S/C26H24ClN3O5/c1-33-23-7-3-5-18(25(23)34-2)24-19-13-17(27)8-9-20(19)30-11-4-6-21(30)22(35-24)10-12-29-15-16(14-28-29)26(31)32/h3-9,11,13-15,22,24H,10,12H2,1-2H3,(H,31,32)/t22-,24-/m1/s1

Standard InChI Key:  KQPAHIXBOYTCDC-ISKFKSNPSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   14.6138   -5.6390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6126   -6.4581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3203   -6.8668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3185   -5.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9312   -6.0239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5121   -5.2403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.6821   -5.0996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0320   -6.4604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0267   -5.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5728   -6.8136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7375   -7.0128    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6688   -7.8689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4618   -8.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0203   -7.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6813   -4.2874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3905   -3.8799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3912   -3.0639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6835   -2.6544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9737   -3.0669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9764   -3.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0973   -4.2894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.0961   -5.1061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0989   -2.6562    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.8058   -3.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8195   -5.9950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2887   -6.7498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9063   -5.2308    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   20.1769   -6.7208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.7226   -7.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5588   -7.1184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5295   -6.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6758   -5.9835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.3068   -7.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2605   -8.4914    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0988   -7.1997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  1  0
  5 10  1  0
 17 18  2  0
 11  8  1  0
 18 19  1  0
  8  9  1  0
 19 20  2  0
 20 15  1  0
  7 15  1  1
  9  7  1  0
 16 21  1  0
 10 11  1  0
 21 22  1  0
  4  1  1  0
 17 23  1  0
 23 24  1  0
  2  3  1  0
  5 25  1  6
  3  8  2  0
 25 26  1  0
  1  2  2  0
  1 27  1  0
 11 12  1  0
 26 28  1  0
 28 29  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  9  4  2  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 28  1  0
  5  6  1  0
 15 16  2  0
  6  7  1  0
 33 34  1  0
 33 35  2  0
 30 33  1  0
M  END

Associated Targets(non-human)

Fdft1 Squalene synthetase (891 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Hepatocyte (2621 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Rattus norvegicus (775804 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 493.95Molecular Weight (Monoisotopic): 493.1404AlogP: 5.29#Rotatable Bonds: 7
Polar Surface Area: 87.74Molecular Species: ACIDHBA: 7HBD: 1
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.43CX Basic pKa: 0.94CX LogP: 4.56CX LogD: 1.16
Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.38Np Likeness Score: -0.87

References

1. Ichikawa M, Ohtsuka M, Ohki H, Haginoya N, Itoh M, Sugita K, Usui H, Suzuki M, Terayama K, Kanda A..  (2012)  Discovery of novel tricyclic compounds as squalene synthase inhibitors.,  20  (9): [PMID:22464687] [10.1016/j.bmc.2012.02.054]

Source