(3beta,5alpha)-3,17-Dihydroxypregnane-11,20-dione

ID: ALA2057980

Cas Number: 570-38-7

PubChem CID: 256280

Max Phase: Preclinical

Molecular Formula: C21H32O4

Molecular Weight: 348.48

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C

Standard InChI:  InChI=1S/C21H32O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)18(15)17(24)11-20(16,21)3/h13-16,18,23,25H,4-11H2,1-3H3/t13-,14-,15-,16-,18+,19-,20-,21-/m0/s1

Standard InChI Key:  AYEXSTRNLGYBSQ-HCMGWXKDSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    2.7500  -25.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7500  -26.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4620  -26.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4620  -25.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1740  -25.7583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1705  -26.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8793  -26.9966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5961  -26.5894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8863  -25.3466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5997  -25.7692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6167  -24.1139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8917  -24.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3300  -24.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3166  -25.3631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0985  -25.6313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3250  -23.7083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3083  -26.1875    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5917  -24.9417    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8792  -26.1708    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1667  -24.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0361  -26.9969    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1625  -27.4042    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5691  -23.6023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3931  -23.6427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1921  -22.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1231  -24.2953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5964  -24.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9458  -24.2917    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1813  -24.1002    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  4  1  0
  2  3  1  0
 14 15  1  0
 15 27  1  0
 26 13  1  0
  5  9  1  0
 13 16  1  1
  6  7  1  0
 14 17  1  6
  7  8  1  0
 10 18  1  1
  8 10  1  0
  9 19  1  6
  9 10  1  0
  5 20  1  1
  3  6  1  0
  2 21  1  1
  5  4  1  0
  6 22  1  6
  5  6  1  0
 26 23  1  1
 23 24  2  0
  9 12  1  0
 23 25  1  0
 27 26  1  0
 10 14  1  0
 13 11  1  0
 11 12  1  0
 26 28  1  0
 13 14  1  0
 12 29  2  0
M  END

Associated Targets(Human)

G6PD Tchem Glucose-6-phosphate 1-dehydrogenase (778 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 348.48Molecular Weight (Monoisotopic): 348.2301AlogP: 2.89#Rotatable Bonds: 1
Polar Surface Area: 74.60Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 12.68CX Basic pKa: CX LogP: 2.32CX LogD: 2.32
Aromatic Rings: Heavy Atoms: 25QED Weighted: 0.76Np Likeness Score: 2.31

References

1. Hamilton NM, Dawson M, Fairweather EE, Hamilton NS, Hitchin JR, James DI, Jones SD, Jordan AM, Lyons AJ, Small HF, Thomson GJ, Waddell ID, Ogilvie DJ..  (2012)  Novel steroid inhibitors of glucose 6-phosphate dehydrogenase.,  55  (9): [PMID:22506561] [10.1021/jm300317k]

Source