The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(3beta,5alpha)-3,17-Dihydroxypregnane-11,20-dione ID: ALA2057980
Cas Number: 570-38-7
PubChem CID: 256280
Max Phase: Preclinical
Molecular Formula: C21H32O4
Molecular Weight: 348.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)[C@@]1(O)CC[C@H]2[C@@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3C(=O)C[C@@]21C
Standard InChI: InChI=1S/C21H32O4/c1-12(22)21(25)9-7-16-15-5-4-13-10-14(23)6-8-19(13,2)18(15)17(24)11-20(16,21)3/h13-16,18,23,25H,4-11H2,1-3H3/t13-,14-,15-,16-,18+,19-,20-,21-/m0/s1
Standard InChI Key: AYEXSTRNLGYBSQ-HCMGWXKDSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
2.7500 -25.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7500 -26.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4620 -26.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4620 -25.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1740 -25.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1705 -26.5833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8793 -26.9966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5961 -26.5894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8863 -25.3466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5997 -25.7692 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6167 -24.1139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8917 -24.5197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3300 -24.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3166 -25.3631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0985 -25.6313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3250 -23.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3083 -26.1875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
5.5917 -24.9417 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.8792 -26.1708 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
4.1667 -24.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0361 -26.9969 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1625 -27.4042 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
7.5691 -23.6023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3931 -23.6427 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1921 -22.8685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1231 -24.2953 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5964 -24.9649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9458 -24.2917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1813 -24.1002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 1 0
14 15 1 0
15 27 1 0
26 13 1 0
5 9 1 0
13 16 1 1
6 7 1 0
14 17 1 6
7 8 1 0
10 18 1 1
8 10 1 0
9 19 1 6
9 10 1 0
5 20 1 1
3 6 1 0
2 21 1 1
5 4 1 0
6 22 1 6
5 6 1 0
26 23 1 1
23 24 2 0
9 12 1 0
23 25 1 0
27 26 1 0
10 14 1 0
13 11 1 0
11 12 1 0
26 28 1 0
13 14 1 0
12 29 2 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 348.48Molecular Weight (Monoisotopic): 348.2301AlogP: 2.89#Rotatable Bonds: 1Polar Surface Area: 74.60Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.68CX Basic pKa: ┄CX LogP: 2.32CX LogD: 2.32Aromatic Rings: ┄Heavy Atoms: 25QED Weighted: 0.76Np Likeness Score: 2.31
References 1. Hamilton NM, Dawson M, Fairweather EE, Hamilton NS, Hitchin JR, James DI, Jones SD, Jordan AM, Lyons AJ, Small HF, Thomson GJ, Waddell ID, Ogilvie DJ.. (2012) Novel steroid inhibitors of glucose 6-phosphate dehydrogenase., 55 (9): [PMID:22506561 ] [10.1021/jm300317k ]