The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(cyclopentyloxy)-2-(3,5-difluorophenyl)-5-(4-(3-hydroxybenzylsulfonyl)piperazin-1-yl)pyridazin-3(2H)-one ID: ALA2059490
PubChem CID: 57768128
Max Phase: Preclinical
Molecular Formula: C26H28F2N4O5S
Molecular Weight: 546.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=c1c(OC2CCCC2)c(N2CCN(S(=O)(=O)Cc3cccc(O)c3)CC2)cnn1-c1cc(F)cc(F)c1
Standard InChI: InChI=1S/C26H28F2N4O5S/c27-19-13-20(28)15-21(14-19)32-26(34)25(37-23-6-1-2-7-23)24(16-29-32)30-8-10-31(11-9-30)38(35,36)17-18-4-3-5-22(33)12-18/h3-5,12-16,23,33H,1-2,6-11,17H2
Standard InChI Key: AVDLDCKDSIRPBY-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
1.1701 2.7110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5866 1.9947 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.9987 2.7135 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.8445 -0.8911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8456 -1.7180 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1312 -2.1307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4153 -1.7175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4181 -0.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1330 -0.4786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7019 -0.4709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9865 -0.8827 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2761 -0.4712 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2749 0.3536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9904 0.7654 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7070 0.3523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4222 0.7626 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5580 0.7625 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1559 0.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8679 0.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8721 1.5816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1582 1.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5599 1.5857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3003 1.5762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0159 1.9858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7269 1.5673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4421 1.9762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4457 2.8016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7281 3.2165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0159 2.8052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5586 -0.4790 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-1.9907 1.5899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7052 2.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7052 2.8286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4889 3.0847 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9747 2.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4911 1.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1393 -2.9525 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.1544 1.5609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5 6 1 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
13 17 1 0
20 2 1 0
6 7 2 0
2 23 1 0
2 1 2 0
23 24 1 0
7 8 1 0
24 25 2 0
10 15 1 0
25 26 1 0
11 12 2 0
26 27 2 0
12 13 1 0
27 28 1 0
13 14 2 0
28 29 2 0
29 24 1 0
14 15 1 0
4 30 1 0
8 10 1 0
14 31 1 0
4 5 2 0
31 32 1 0
32 33 1 0
15 16 2 0
17 18 1 0
8 9 2 0
9 4 1 0
33 34 1 0
34 35 1 0
35 36 1 0
36 32 1 0
10 11 1 0
6 37 1 0
3 2 2 0
26 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 546.60Molecular Weight (Monoisotopic): 546.1748AlogP: 3.19#Rotatable Bonds: 7Polar Surface Area: 104.97Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.40CX Basic pKa: 0.97CX LogP: 2.91CX LogD: 2.90Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.49Np Likeness Score: -1.20
References 1. Kuang R, Wu H, Ting PC, Aslanian RG, Cao J, Kim DW, Lee JF, Schwerdt J, Zhou G, Herr RJ, Zych AJ, Yang J, Lam SQ, Jenkins DM, Sakwa SA, Wainhaus S, Black TA, Cacciapuoti A, McNicholas PM, Xu Y, Walker SS.. (2012) The optimization of pyridazinone series of glucan synthase inhibitors., 22 (16): [PMID:22818082 ] [10.1016/j.bmcl.2012.06.091 ]