The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(4-(4-amino-3-isopropylbenzylsulfonyl)piperazin-1-yl)-2-(3-chlorophenyl)-4-((1-methylcyclopropyl)methoxy)pyridazin-3(2H)-one ID: ALA2059639
PubChem CID: 57768337
Max Phase: Preclinical
Molecular Formula: C29H36ClN5O4S
Molecular Weight: 586.16
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)c1cc(CS(=O)(=O)N2CCN(c3cnn(-c4cccc(Cl)c4)c(=O)c3OCC3(C)CC3)CC2)ccc1N
Standard InChI: InChI=1S/C29H36ClN5O4S/c1-20(2)24-15-21(7-8-25(24)31)18-40(37,38)34-13-11-33(12-14-34)26-17-32-35(23-6-4-5-22(30)16-23)28(36)27(26)39-19-29(3)9-10-29/h4-8,15-17,20H,9-14,18-19,31H2,1-3H3
Standard InChI Key: UOFIXAXEIZCXEK-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 44 0 0 0 0 0 0 0 0999 V2000
13.9614 1.5624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3780 0.8457 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
14.7903 1.5649 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9438 -2.0414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9426 -2.8688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6574 -3.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3737 -2.8683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3708 -2.0378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6556 -1.6288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0874 -1.6211 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8032 -2.0330 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.5140 -1.6214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5152 -0.7961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7993 -0.3842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0824 -0.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3668 -0.3870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2324 -0.3871 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9467 -0.8017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6589 -0.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6632 0.4325 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9490 0.8471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2304 0.4366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0920 0.4271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8080 0.8368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5194 0.4182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2349 0.8272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2384 1.6531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5206 2.0681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8080 1.6567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2292 -1.6292 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
10.7990 0.4408 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0845 0.8530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0842 1.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4983 2.3892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6734 2.3889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3659 1.2707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9538 2.0638 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.9475 0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9439 -0.4132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6637 0.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 22 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
13 17 1 0
20 2 1 0
6 7 2 0
2 23 1 0
2 1 2 0
23 24 1 0
7 8 1 0
24 25 2 0
10 15 1 0
25 26 1 0
11 12 2 0
26 27 2 0
12 13 1 0
27 28 1 0
13 14 2 0
28 29 2 0
29 24 1 0
14 15 1 0
4 30 1 0
8 10 1 0
14 31 1 0
4 5 2 0
31 32 1 0
15 16 2 0
32 33 1 0
34 33 1 0
35 34 1 0
33 35 1 0
17 18 1 0
8 9 2 0
9 4 1 0
33 36 1 0
10 11 1 0
27 37 1 0
3 2 2 0
26 38 1 0
5 6 1 0
38 39 1 0
38 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.16Molecular Weight (Monoisotopic): 585.2177AlogP: 4.42#Rotatable Bonds: 9Polar Surface Area: 110.76Molecular Species: NEUTRALHBA: 8HBD: 1#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 3.90CX LogP: 3.75CX LogD: 3.75Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.37Np Likeness Score: -1.09
References 1. Kuang R, Wu H, Ting PC, Aslanian RG, Cao J, Kim DW, Lee JF, Schwerdt J, Zhou G, Herr RJ, Zych AJ, Yang J, Lam SQ, Jenkins DM, Sakwa SA, Wainhaus S, Black TA, Cacciapuoti A, McNicholas PM, Xu Y, Walker SS.. (2012) The optimization of pyridazinone series of glucan synthase inhibitors., 22 (16): [PMID:22818082 ] [10.1016/j.bmcl.2012.06.091 ]