The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Purealin ID: ALA206161
Max Phase: Preclinical
Molecular Formula: C27H29Br4N7O7
Molecular Weight: 883.19
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Purealin
Canonical SMILES: COC1=C(Br)[C@@H](O)[C@]2(C=C1Br)CC(C(=O)NCCCOc1c(Br)cc(C/C(=N/O)C(=O)NCCc3c[nH]c(N)n3)cc1Br)=NO2
Standard InChI: InChI=1S/C27H29Br4N7O7/c1-43-22-17(30)10-27(23(39)20(22)31)11-19(38-45-27)25(41)33-4-2-6-44-21-15(28)7-13(8-16(21)29)9-18(37-42)24(40)34-5-3-14-12-35-26(32)36-14/h7-8,10,12,23,39,42H,2-6,9,11H2,1H3,(H,33,41)(H,34,40)(H3,32,35,36)/b37-18-/t23-,27+/m1/s1
Standard InChI Key: FFJLRVBPVWKFTA-BAPZPQAKSA-N
Molfile:
RDKit 2D
45 48 0 0 1 0 0 0 0 0999 V2000
-1.3920 1.3799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9836 2.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3981 2.8033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2209 2.7989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6274 2.0796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2105 1.3737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5027 -0.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5016 -0.8565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2164 -1.2694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9328 -0.8560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9300 -0.0255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2146 0.3836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2121 1.2086 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.7868 -1.2684 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
3.7882 0.3832 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0738 -0.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3592 0.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6449 -0.0298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9303 0.3825 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2159 -0.0302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4987 0.3822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2161 -0.8552 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5821 1.2060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8015 0.6627 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2492 0.0499 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6168 0.6557 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6397 3.5125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4647 3.5065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9895 3.5200 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
-3.4523 2.0718 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
6.6480 -1.2674 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3618 -0.8538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0769 -1.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3605 -0.0288 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0743 0.3848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7907 -0.8515 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0782 -2.0902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5058 -1.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2197 -0.8493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9348 -1.2607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8263 -2.2584 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2380 -1.5468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6772 -0.9244 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0192 -2.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0585 -1.4608 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
21 23 1 0
5 6 1 0
11 12 2 0
12 7 1 0
1 23 1 6
1 24 1 1
24 25 1 0
25 21 2 0
6 1 1 0
6 26 1 6
12 13 1 0
1 2 1 0
27 28 1 0
4 27 1 0
8 14 1 0
3 29 1 0
3 4 1 0
5 30 1 0
7 15 1 0
10 31 1 0
7 8 2 0
31 32 1 0
15 16 1 0
32 33 1 0
32 34 2 0
16 17 1 0
34 35 1 0
8 9 1 0
33 36 1 0
17 18 1 0
33 37 2 0
4 5 2 0
36 38 1 0
18 19 1 0
38 39 1 0
9 10 2 0
39 40 1 0
19 20 1 0
2 3 2 0
20 21 1 0
10 11 1 0
41 42 1 0
42 43 2 0
43 40 1 0
40 44 2 0
44 41 1 0
20 22 2 0
42 45 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 883.19Molecular Weight (Monoisotopic): 878.8862AlogP: 3.55#Rotatable Bonds: 13Polar Surface Area: 205.77Molecular Species: BASEHBA: 11HBD: 6#RO5 Violations: 3HBA (Lipinski): 14HBD (Lipinski): 7#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.27CX Basic pKa: 9.01CX LogP: 1.62CX LogD: 1.37Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.08Np Likeness Score: 1.20
References 1. Zhu G, Yang F, Balachandran R, Höök P, Vallee RB, Curran DP, Day BW.. (2006) Synthesis and biological evaluation of purealin and analogues as cytoplasmic dynein heavy chain inhibitors., 49 (6): [PMID:16539395 ] [10.1021/jm051030l ]