The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-hydroxymethyl-3-[(Z)-3-isobutyl-5-methylhexylidene]-5-octanoyloxymethyltetrahydro-2-furanone ID: ALA206332
PubChem CID: 11502757
Max Phase: Preclinical
Molecular Formula: C25H44O5
Molecular Weight: 424.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC(=O)OCC1(CO)C/C(=C/CC(CC(C)C)CC(C)C)C(=O)O1
Standard InChI: InChI=1S/C25H44O5/c1-6-7-8-9-10-11-23(27)29-18-25(17-26)16-22(24(28)30-25)13-12-21(14-19(2)3)15-20(4)5/h13,19-21,26H,6-12,14-18H2,1-5H3/b22-13-
Standard InChI Key: UJBGCVAQDSYQPK-XKZIYDEJSA-N
Molfile:
RDKit 2D
30 30 0 0 0 0 0 0 0 0999 V2000
14.2297 -11.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7138 -11.7383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5344 -11.6530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3774 -12.4915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5568 -12.5768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2204 -13.3301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0727 -11.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8709 -10.8997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.6914 -10.8144 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3867 -10.2317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4091 -11.1555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1000 -10.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9250 -10.4875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.1818 -9.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5125 -9.2167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.8474 -9.7034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9667 -9.4496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2583 -9.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1292 -10.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4190 -9.6885 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4731 -8.3159 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8906 -7.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0934 -7.9440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5109 -7.3597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7137 -7.5720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1312 -6.9878 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1053 -6.9351 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.3340 -7.2001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7515 -6.6159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9543 -6.8282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15 16 1 0
16 12 1 0
14 17 2 0
8 9 1 0
16 18 1 0
4 5 1 0
16 19 1 0
8 10 1 0
19 20 1 0
13 11 2 0
2 3 1 0
18 21 1 0
1 11 1 0
21 22 1 0
12 13 1 0
22 23 1 0
5 6 1 0
23 24 1 0
1 2 1 0
24 25 1 0
5 7 1 0
25 26 1 0
2 4 1 0
22 27 2 0
3 8 1 0
26 28 1 0
13 14 1 0
28 29 1 0
14 15 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 424.62Molecular Weight (Monoisotopic): 424.3189AlogP: 5.59#Rotatable Bonds: 15Polar Surface Area: 72.83Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 6.72CX LogD: 6.72Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.21Np Likeness Score: 1.24
References 1. Lee J, Kang JH, Han KC, Kim Y, Kim SY, Youn HS, Mook-Jung I, Kim H, Lo Han JH, Ha HJ, Kim YH, Marquez VE, Lewin NE, Pearce LV, Lundberg DJ, Blumberg PM.. (2006) Branched diacylglycerol-lactones as potent protein kinase C ligands and alpha-secretase activators., 49 (6): [PMID:16539391 ] [10.1021/jm0509391 ]