The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
triphenyl-[2-(triphenyl-lambda-5-phosphanyl)ethyl]-lamda-5-phosphane ID: ALA2063509
Max Phase: Preclinical
Molecular Formula: C38H36P2
Molecular Weight: 554.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: NSC-64111
Canonical SMILES: c1ccc([PH](CC[PH](c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1
Standard InChI: InChI=1S/C38H36P2/c1-7-19-33(20-8-1)39(34-21-9-2-10-22-34,35-23-11-3-12-24-35)31-32-40(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-30,39-40H,31-32H2
Standard InChI Key: WDTAKLSLSSTQOJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
1.4688 -5.8126 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
2.1843 -5.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8998 -5.8126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6153 -5.3995 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
3.6153 -4.5733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3340 -4.1635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3344 -3.3381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6183 -2.9242 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9004 -3.3417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9036 -4.1658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7533 -5.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7583 -4.5722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0436 -4.1592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6729 -4.5723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6703 -5.4028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0450 -5.8121 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4106 -5.1783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9985 -5.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7931 -5.5386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9999 -4.7385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4058 -4.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6135 -4.3829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0225 -6.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6088 -6.8156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0153 -7.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8341 -7.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2447 -6.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8358 -6.1088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8805 -6.3967 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0800 -6.1763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5080 -6.7597 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2965 -7.5623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5084 -7.7782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0930 -7.1934 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8777 -6.5261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4613 -7.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8695 -7.9496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6928 -7.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1062 -7.2368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6955 -6.5266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9 10 2 0
19 20 2 0
10 5 1 0
20 21 1 0
2 3 1 0
21 22 2 0
22 17 1 0
1 11 1 0
4 23 1 0
5 6 2 0
23 24 2 0
11 12 2 0
24 25 1 0
1 2 1 0
25 26 2 0
12 13 1 0
26 27 1 0
6 7 1 0
27 28 2 0
28 23 1 0
13 14 2 0
1 29 1 0
3 4 1 0
29 30 2 0
14 15 1 0
30 31 1 0
7 8 2 0
31 32 2 0
15 16 2 0
32 33 1 0
16 11 1 0
33 34 2 0
34 29 1 0
1 35 1 0
4 17 1 0
35 36 2 0
8 9 1 0
36 37 1 0
17 18 2 0
37 38 2 0
4 5 1 0
38 39 1 0
18 19 1 0
39 40 2 0
40 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 554.65Molecular Weight (Monoisotopic): 554.2292AlogP: 6.44#Rotatable Bonds: 9Polar Surface Area: 0.00Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: 2HBA (Lipinski): ┄HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.37CX LogD: 9.37Aromatic Rings: 6Heavy Atoms: 40QED Weighted: 0.18Np Likeness Score: -0.05
References 1. Roldós V, Carbajo RJ, Schott AK, Pineda-Lucena A, Ochoa-Callejero L, Martínez A, Ramos A, de Pascual-Teresa B.. (2012) Identification of first proadrenomedullin N-terminal 20 peptide (PAMP) modulator by means of virtual screening and NMR interaction experiments., 55 [PMID:22884224 ] [10.1016/j.ejmech.2012.07.031 ]