8-{4-[(Triphenyl-lambda-5-phosphanyl)-methyl]-phenyl}-7H-purin-6-ylamine

ID: ALA2063512

Max Phase: Preclinical

Molecular Formula: C30H26N5P

Molecular Weight: 487.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: NSC-211736

Canonical SMILES:  Nc1ncnc2nc(-c3ccc(C[PH](c4ccccc4)(c4ccccc4)c4ccccc4)cc3)[nH]c12

Standard InChI:  InChI=1S/C30H26N5P/c31-28-27-30(33-21-32-28)35-29(34-27)23-18-16-22(17-19-23)20-36(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-19,21,36H,20H2,(H3,31,32,33,34,35)

Standard InChI Key:  NOONORHLAFLQSJ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  0  0  0  0  0  0999 V2000
   -4.2920   -0.2880    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2932   -1.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5771   -1.5315    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5789    0.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8624   -0.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8621   -1.1116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0792   -1.3699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5915   -0.6997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0796   -0.0299    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5814    0.9488    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7689   -0.7006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3543   -1.4177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4707   -1.4178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8820   -0.7015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4666    0.0165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3570    0.0130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7078   -0.7001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1216    0.0164    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    2.8430    0.4166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7054    0.7313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1234    1.4497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7079    2.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8813    2.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4719    1.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8855    0.7302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5509   -0.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2748    0.3754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2932    1.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5816    1.6321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8605    1.2352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5036   -0.7105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0652   -1.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4460   -2.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2679   -2.1641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7075   -1.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3201   -0.7394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9  5  1  0
  4 10  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 16 11  1  0
  8 11  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 19 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 29 30  2  0
 30 19  1  0
 18 31  1  0
 31 32  2  0
 32 33  1  0
 33 34  2  0
 34 35  1  0
 35 36  2  0
 36 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA2063512

    ---

Associated Targets(Human)

ADM Tbio ADM (35 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 487.55Molecular Weight (Monoisotopic): 487.1926AlogP: 4.83#Rotatable Bonds: 6
Polar Surface Area: 80.48Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 9.73CX Basic pKa: 3.59CX LogP: 6.34CX LogD: 6.33
Aromatic Rings: 6Heavy Atoms: 36QED Weighted: 0.33Np Likeness Score: -0.32

References

1. Roldós V, Carbajo RJ, Schott AK, Pineda-Lucena A, Ochoa-Callejero L, Martínez A, Ramos A, de Pascual-Teresa B..  (2012)  Identification of first proadrenomedullin N-terminal 20 peptide (PAMP) modulator by means of virtual screening and NMR interaction experiments.,  55  [PMID:22884224] [10.1016/j.ejmech.2012.07.031]

Source