The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Lipopurealin A ID: ALA206373
Max Phase: Preclinical
Molecular Formula: C31H48Br2N6O4
Molecular Weight: 728.57
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCCCC(=O)NCCCOc1c(Br)cc(C/C(=N/O)C(=O)NCCc2c[nH]c(N)n2)cc1Br
Standard InChI: InChI=1S/C31H48Br2N6O4/c1-2-3-4-5-6-7-8-9-10-11-12-14-28(40)35-16-13-18-43-29-25(32)19-23(20-26(29)33)21-27(39-42)30(41)36-17-15-24-22-37-31(34)38-24/h19-20,22,42H,2-18,21H2,1H3,(H,35,40)(H,36,41)(H3,34,37,38)/b39-27-
Standard InChI Key: GKUJVGYRWHGSBN-NOACJBATSA-N
Molfile:
RDKit 2D
43 44 0 0 0 0 0 0 0 0999 V2000
6.5986 -4.6708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5974 -5.4982 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3122 -5.9110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0287 -5.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0258 -4.6672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3104 -4.2580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3080 -3.4330 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.8826 -5.9101 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
5.8840 -4.2585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1696 -4.6711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4551 -4.2588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7407 -4.6715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0261 -4.2592 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3117 -4.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5972 -4.2595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3119 -5.4968 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.7438 -5.9091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4576 -5.4954 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1727 -5.9068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4563 -4.6704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1701 -4.2568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8865 -5.4932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.1740 -6.7318 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.6017 -5.9046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3155 -5.4910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0306 -5.9023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9221 -6.9001 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.3339 -6.1885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7731 -5.5661 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.1150 -6.7217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1544 -6.1025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5970 -3.4345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8824 -3.0222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1680 -3.4348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1682 -4.2598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5461 -4.6725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2607 -4.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2609 -3.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9755 -3.0228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6899 -3.4355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6897 -4.2605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4040 -4.6732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1186 -4.2609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
19 22 1 0
10 11 1 0
19 23 2 0
5 6 2 0
22 24 1 0
11 12 1 0
24 25 1 0
6 1 1 0
25 26 1 0
12 13 1 0
1 2 2 0
13 14 1 0
6 7 1 0
27 28 1 0
28 29 2 0
29 26 1 0
26 30 2 0
30 27 1 0
14 15 1 0
28 31 1 0
3 4 2 0
15 32 1 0
14 16 2 0
32 33 1 0
2 8 1 0
33 34 1 0
4 17 1 0
34 35 1 0
35 36 1 0
17 18 1 0
36 37 1 0
1 9 1 0
37 38 1 0
18 19 1 0
38 39 1 0
4 5 1 0
39 40 1 0
18 20 2 0
40 41 1 0
9 10 1 0
41 42 1 0
20 21 1 0
42 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 728.57Molecular Weight (Monoisotopic): 726.2104AlogP: 6.83#Rotatable Bonds: 23Polar Surface Area: 154.72Molecular Species: BASEHBA: 7HBD: 5#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 6#RO5 Violations (Lipinski): 3CX Acidic pKa: 8.27CX Basic pKa: 9.01CX LogP: 6.11CX LogD: 5.86Aromatic Rings: 2Heavy Atoms: 43QED Weighted: 0.04Np Likeness Score: 0.07
References 1. Zhu G, Yang F, Balachandran R, Höök P, Vallee RB, Curran DP, Day BW.. (2006) Synthesis and biological evaluation of purealin and analogues as cytoplasmic dynein heavy chain inhibitors., 49 (6): [PMID:16539395 ] [10.1021/jm051030l ]