The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-((S)-2-((S)-2-((S)-2,3-Dihydroxypropylamino)propanamido)-3-methylbutanoyl)-N-(2,2-diphenylethyl)pyrrolidine-2-carboxamide ID: ALA2063865
PubChem CID: 57522924
Max Phase: Preclinical
Molecular Formula: C30H42N4O5
Molecular Weight: 538.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H](NC(=O)[C@H](C)NC[C@H](O)CO)C(=O)N1CCC[C@H]1C(=O)NCC(c1ccccc1)c1ccccc1
Standard InChI: InChI=1S/C30H42N4O5/c1-20(2)27(33-28(37)21(3)31-17-24(36)19-35)30(39)34-16-10-15-26(34)29(38)32-18-25(22-11-6-4-7-12-22)23-13-8-5-9-14-23/h4-9,11-14,20-21,24-27,31,35-36H,10,15-19H2,1-3H3,(H,32,38)(H,33,37)/t21-,24-,26-,27-/m0/s1
Standard InChI Key: CULLTURVHZXDJG-OIMINJBOSA-N
Molfile:
RDKit 2D
39 41 0 0 0 0 0 0 0 0999 V2000
12.0625 -6.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.7770 -5.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2860 -5.7715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7814 -6.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2465 -7.1064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.0382 -6.8746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7770 -4.8125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.4914 -6.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.4914 -6.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2059 -5.6375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.9204 -6.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9204 -6.8750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6349 -5.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3493 -6.0500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6349 -4.8125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7770 -7.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2059 -7.2875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0638 -5.6375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8760 -5.0556 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2910 -4.3426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0510 -5.0526 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.6360 -5.7657 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8110 -5.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3960 -6.4758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4010 -5.0468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8194 -4.3357 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4101 -3.6202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5842 -3.6169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1694 -4.3349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5810 -5.0474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5707 -6.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1558 -7.1821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5658 -7.8990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3950 -7.8993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8063 -7.1865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7783 -6.0500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7783 -6.8750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4927 -5.6375 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0638 -7.2875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 4 1 0
19 20 2 0
8 10 1 0
19 21 1 0
4 5 1 0
21 22 1 0
10 11 1 0
22 23 1 0
5 6 1 0
23 24 1 0
11 12 2 0
23 25 1 0
6 1 1 0
25 26 2 0
11 13 1 0
26 27 1 0
1 2 1 0
27 28 2 0
13 14 1 0
28 29 1 0
2 7 2 0
29 30 2 0
30 25 1 0
13 15 1 6
24 31 2 0
1 3 1 0
31 32 1 0
9 16 1 0
32 33 2 0
2 8 1 0
33 34 1 0
9 17 1 0
34 35 2 0
35 24 1 0
36 18 1 6
14 18 1 0
36 37 1 0
8 9 1 1
36 38 1 0
3 19 1 1
37 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.69Molecular Weight (Monoisotopic): 538.3155AlogP: 1.40#Rotatable Bonds: 13Polar Surface Area: 131.00Molecular Species: NEUTRALHBA: 6HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.39CX Basic pKa: 7.78CX LogP: 1.55CX LogD: 1.02Aromatic Rings: 2Heavy Atoms: 39QED Weighted: 0.26Np Likeness Score: -0.35
References 1. Flygare JA, Beresini M, Budha N, Chan H, Chan IT, Cheeti S, Cohen F, Deshayes K, Doerner K, Eckhardt SG, Elliott LO, Feng B, Franklin MC, Reisner SF, Gazzard L, Halladay J, Hymowitz SG, La H, LoRusso P, Maurer B, Murray L, Plise E, Quan C, Stephan JP, Young SG, Tom J, Tsui V, Um J, Varfolomeev E, Vucic D, Wagner AJ, Wallweber HJ, Wang L, Ware J, Wen Z, Wong H, Wong JM, Wong M, Wong S, Yu R, Zobel K, Fairbrother WJ.. (2012) Discovery of a potent small-molecule antagonist of inhibitor of apoptosis (IAP) proteins and clinical candidate for the treatment of cancer (GDC-0152)., 55 (9): [PMID:22413863 ] [10.1021/jm300060k ]