The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-1-((S)-2-Cyclohexyl-2-((S)-2-(methylamino)-propanamido)acetyl)-N-(2,2-diphenylethyl)pyrrolidine-2-carboxamide ID: ALA2063866
PubChem CID: 57522925
Max Phase: Preclinical
Molecular Formula: C31H42N4O3
Molecular Weight: 518.70
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN[C@@H](C)C(=O)N[C@H](C(=O)N1CCC[C@H]1C(=O)NCC(c1ccccc1)c1ccccc1)C1CCCCC1
Standard InChI: InChI=1S/C31H42N4O3/c1-22(32-2)29(36)34-28(25-17-10-5-11-18-25)31(38)35-20-12-19-27(35)30(37)33-21-26(23-13-6-3-7-14-23)24-15-8-4-9-16-24/h3-4,6-9,13-16,22,25-28,32H,5,10-12,17-21H2,1-2H3,(H,33,37)(H,34,36)/t22-,27-,28-/m0/s1
Standard InChI Key: FDYCYWOLTSESDK-FAQZDJIUSA-N
Molfile:
RDKit 2D
38 41 0 0 0 0 0 0 0 0999 V2000
-0.5208 -12.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.1936 -11.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2973 -11.9590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8019 -12.6125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3368 -13.2939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5451 -13.0621 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1936 -11.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9081 -12.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9081 -13.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6226 -11.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3371 -12.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3371 -13.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0515 -11.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7660 -12.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.0515 -11.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4805 -11.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7073 -11.2431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2923 -10.5301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5323 -11.2401 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9473 -11.9532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7723 -11.9502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1873 -12.6633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1823 -11.2343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7639 -10.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1732 -9.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9991 -9.8044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4140 -10.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0023 -11.2349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0126 -12.6574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4276 -13.3696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0176 -14.0865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1883 -14.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7771 -13.3740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1897 -13.4700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1877 -14.2914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9003 -14.7078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6166 -14.2965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6203 -13.4689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 19 1 0
3 4 1 0
19 20 1 0
8 10 1 0
20 21 1 0
4 5 1 0
21 22 1 0
10 11 1 0
21 23 1 0
5 6 1 0
23 24 2 0
11 12 2 0
24 25 1 0
6 1 1 0
25 26 2 0
11 13 1 0
26 27 1 0
1 2 1 0
27 28 2 0
28 23 1 0
13 14 1 0
22 29 2 0
2 7 2 0
29 30 1 0
13 15 1 6
30 31 2 0
1 3 1 0
31 32 1 0
14 16 1 0
32 33 2 0
33 22 1 0
9 34 1 0
2 8 1 0
3 17 1 1
17 18 2 0
8 9 1 1
9 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 518.70Molecular Weight (Monoisotopic): 518.3257AlogP: 3.60#Rotatable Bonds: 10Polar Surface Area: 90.54Molecular Species: BASEHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.51CX Basic pKa: 8.60CX LogP: 3.74CX LogD: 2.51Aromatic Rings: 2Heavy Atoms: 38QED Weighted: 0.45Np Likeness Score: -0.44
References 1. Flygare JA, Beresini M, Budha N, Chan H, Chan IT, Cheeti S, Cohen F, Deshayes K, Doerner K, Eckhardt SG, Elliott LO, Feng B, Franklin MC, Reisner SF, Gazzard L, Halladay J, Hymowitz SG, La H, LoRusso P, Maurer B, Murray L, Plise E, Quan C, Stephan JP, Young SG, Tom J, Tsui V, Um J, Varfolomeev E, Vucic D, Wagner AJ, Wallweber HJ, Wang L, Ware J, Wen Z, Wong H, Wong JM, Wong M, Wong S, Yu R, Zobel K, Fairbrother WJ.. (2012) Discovery of a potent small-molecule antagonist of inhibitor of apoptosis (IAP) proteins and clinical candidate for the treatment of cancer (GDC-0152)., 55 (9): [PMID:22413863 ] [10.1021/jm300060k ]