1-(4-(2,2-difluoroethyl)phenyl)-4-(4-(hydroxydiphenylmethyl)piperidin-1-yl)butan-1-one

ID: ALA206576

PubChem CID: 44411399

Max Phase: Preclinical

Molecular Formula: C30H33F2NO2

Molecular Weight: 477.60

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(CCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1)c1ccc(CC(F)F)cc1

Standard InChI:  InChI=1S/C30H33F2NO2/c31-29(32)22-23-13-15-24(16-14-23)28(34)12-7-19-33-20-17-27(18-21-33)30(35,25-8-3-1-4-9-25)26-10-5-2-6-11-26/h1-6,8-11,13-16,27,29,35H,7,12,17-22H2

Standard InChI Key:  YMMLGNYBWKPZNI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -4.8083   -5.5208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9833   -5.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1583   -5.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9833   -4.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9833   -6.3458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2686   -4.2816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2683   -3.4574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9833   -3.0440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7001   -3.4610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6969   -4.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6980   -6.7601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6984   -7.5843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9834   -7.9976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2665   -7.5807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2697   -6.7578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7471   -6.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9257   -6.2391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5093   -5.5265    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9206   -4.8102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7482   -4.8065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6843   -5.5296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2745   -6.2456    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5505   -6.2487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9603   -6.9648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7853   -6.9679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5451   -7.6777    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1909   -7.6861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0151   -7.6896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4312   -6.9761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0169   -6.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1941   -6.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2562   -6.9782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6669   -7.6936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4919   -7.6957    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.2527   -8.4071    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  1  0
  2  5  1  0
  9 10  2  0
  3 20  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 10  4  1  0
 18 21  1  0
  2  3  1  0
 21 22  1  0
  5 11  2  0
 22 23  1  0
  4  6  2  0
 23 24  1  0
 11 12  1  0
 24 25  1  0
  1  2  1  0
 24 26  2  0
 12 13  2  0
 25 27  2  0
  6  7  1  0
 27 28  1  0
 13 14  1  0
 28 29  2  0
  2  4  1  0
 29 30  1  0
 14 15  2  0
 30 31  2  0
 31 25  1  0
 15  5  1  0
 29 32  1  0
  3 16  1  0
 32 33  1  0
  7  8  2  0
 33 34  1  0
 33 35  1  0
M  END

Associated Targets(Human)

CYP2J2 Tchem Cytochrome P450 2J2 (258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 477.60Molecular Weight (Monoisotopic): 477.2479AlogP: 6.11#Rotatable Bonds: 10
Polar Surface Area: 40.54Molecular Species: NEUTRALHBA: 3HBD: 1
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.22CX Basic pKa: 8.40CX LogP: 5.47CX LogD: 4.43
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -0.66

References

1. Lafite P, Dijols S, Buisson D, Macherey AC, Zeldin DC, Dansette PM, Mansuy D..  (2006)  Design and synthesis of selective, high-affinity inhibitors of human cytochrome P450 2J2.,  16  (10): [PMID:16495056] [10.1016/j.bmcl.2006.02.004]

Source