The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-(2,2-difluoroethyl)phenyl)-4-(4-(hydroxydiphenylmethyl)piperidin-1-yl)butan-1-one ID: ALA206576
PubChem CID: 44411399
Max Phase: Preclinical
Molecular Formula: C30H33F2NO2
Molecular Weight: 477.60
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1)c1ccc(CC(F)F)cc1
Standard InChI: InChI=1S/C30H33F2NO2/c31-29(32)22-23-13-15-24(16-14-23)28(34)12-7-19-33-20-17-27(18-21-33)30(35,25-8-3-1-4-9-25)26-10-5-2-6-11-26/h1-6,8-11,13-16,27,29,35H,7,12,17-22H2
Standard InChI Key: YMMLGNYBWKPZNI-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-4.8083 -5.5208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9833 -5.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1583 -5.5208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9833 -4.6958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9833 -6.3458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2686 -4.2816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2683 -3.4574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9833 -3.0440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7001 -3.4610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6969 -4.2838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6980 -6.7601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6984 -7.5843 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9834 -7.9976 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2665 -7.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2697 -6.7578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7471 -6.2371 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9257 -6.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5093 -5.5265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.9206 -4.8102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7482 -4.8065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6843 -5.5296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2745 -6.2456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5505 -6.2487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9603 -6.9648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7853 -6.9679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5451 -7.6777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1909 -7.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0151 -7.6896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4312 -6.9761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0169 -6.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1941 -6.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2562 -6.9782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6669 -7.6936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4919 -7.6957 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.2527 -8.4071 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
2 5 1 0
9 10 2 0
3 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
10 4 1 0
18 21 1 0
2 3 1 0
21 22 1 0
5 11 2 0
22 23 1 0
4 6 2 0
23 24 1 0
11 12 1 0
24 25 1 0
1 2 1 0
24 26 2 0
12 13 2 0
25 27 2 0
6 7 1 0
27 28 1 0
13 14 1 0
28 29 2 0
2 4 1 0
29 30 1 0
14 15 2 0
30 31 2 0
31 25 1 0
15 5 1 0
29 32 1 0
3 16 1 0
32 33 1 0
7 8 2 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 477.60Molecular Weight (Monoisotopic): 477.2479AlogP: 6.11#Rotatable Bonds: 10Polar Surface Area: 40.54Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.22CX Basic pKa: 8.40CX LogP: 5.47CX LogD: 4.43Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.36Np Likeness Score: -0.66
References 1. Lafite P, Dijols S, Buisson D, Macherey AC, Zeldin DC, Dansette PM, Mansuy D.. (2006) Design and synthesis of selective, high-affinity inhibitors of human cytochrome P450 2J2., 16 (10): [PMID:16495056 ] [10.1016/j.bmcl.2006.02.004 ]