1-(9-((2R,3R,4S,5S)-5-(ethylcarbamoyl)-3,4-dihydroxy-tetrahydrofuran-2-yl)-9H-purin-6-yl)-3-(4-propoxyphenyl)urea

ID: ALA206807

PubChem CID: 10648594

Max Phase: Preclinical

Molecular Formula: C22H27N7O6

Molecular Weight: 485.50

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCCOc1ccc(NC(=O)Nc2ncnc3c2ncn3[C@@H]2O[C@H](C(=O)NCC)[C@@H](O)[C@H]2O)cc1

Standard InChI:  InChI=1S/C22H27N7O6/c1-3-9-34-13-7-5-12(6-8-13)27-22(33)28-18-14-19(25-10-24-18)29(11-26-14)21-16(31)15(30)17(35-21)20(32)23-4-2/h5-8,10-11,15-17,21,30-31H,3-4,9H2,1-2H3,(H,23,32)(H2,24,25,27,28,33)/t15-,16+,17-,21+/m0/s1

Standard InChI Key:  ALQXBWHXWIDDKS-GRXQJBFDSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  1  0  0  0  0  0999 V2000
    0.5787  -20.5989    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1977  -20.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2454  -21.0838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8403  -19.8090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4621  -21.6660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8600  -20.3928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9104  -20.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3297  -21.9052    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6527  -19.8131    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2815  -21.6618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0201  -22.3425    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5318  -20.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6630  -20.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0859  -22.2447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7749  -22.3300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3198  -20.6226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7502  -21.7591    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3357  -20.4516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4940  -19.8200    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9330  -21.1773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7132  -20.9215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3221  -21.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0897  -20.7863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7566  -20.3006    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1769  -21.6066    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9310  -21.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0133  -22.7595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7665  -23.0942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4344  -22.6083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3441  -21.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5907  -21.4530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1889  -22.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.8551  -22.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6096  -22.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6979  -23.6094    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 13 17  1  0
 13 18  1  0
 16 19  2  0
  7  9  1  0
 10 12  1  0
 14 17  2  0
 16 20  1  0
  2  1  1  1
 20 21  1  0
  1  3  1  0
 21 22  1  0
  1  4  1  0
 18 23  1  0
  5  2  1  0
 23 24  2  0
  2  6  1  0
 23 25  1  0
  3  7  1  0
 25 26  1  0
  3  8  2  0
 26 27  2  0
  4  9  2  0
 27 28  1  0
  5 10  1  0
 28 29  2  0
  5 11  1  6
 29 30  1  0
  6 12  1  0
 30 31  2  0
 31 26  1  0
  7 13  2  0
 29 32  1  0
  8 14  1  0
 32 33  1  0
 10 15  1  6
 33 34  1  0
 12 16  1  1
 34 35  1  0
M  END

Associated Targets(non-human)

Adora3 Adenosine A3 receptor (846 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 485.50Molecular Weight (Monoisotopic): 485.2023AlogP: 1.01#Rotatable Bonds: 8
Polar Surface Area: 172.75Molecular Species: NEUTRALHBA: 10HBD: 5
#RO5 Violations: HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.48CX Basic pKa: 2.15CX LogP: 0.70CX LogD: 0.70
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.31Np Likeness Score: -0.46

References

1. González MP, Terán C, Teijeira M..  (2006)  A topological function based on spectral moments for predicting affinity toward A3 adenosine receptors.,  16  (5): [PMID:16356715] [10.1016/j.bmcl.2005.11.063]

Source