2-(16-Acetoxy-3,11-dihydroxy-4,8,10,14-tetramethyl-hexadecahydro-cyclopenta[a]phenanthren-17-yl)-6-methyl-heptanoic acid

ID: ALA2068985

PubChem CID: 70692994

Max Phase: Preclinical

Molecular Formula: C31H52O6

Molecular Weight: 520.75

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@H]1C[C@@]2(C)C(CC(O)[C@H]3[C@@]4(C)CCC(O)C(C)C4CC[C@@]32C)[C@@H]1[C@H](CCCC(C)C)C(=O)O

Standard InChI:  InChI=1S/C31H52O6/c1-17(2)9-8-10-20(28(35)36)26-22-15-24(34)27-29(5)13-12-23(33)18(3)21(29)11-14-30(27,6)31(22,7)16-25(26)37-19(4)32/h17-18,20-27,33-34H,8-16H2,1-7H3,(H,35,36)/t18?,20-,21?,22?,23?,24?,25-,26-,27-,29-,30-,31-/m0/s1

Standard InChI Key:  JRYUAVAYESKHSZ-XGVGIWRASA-N

Molfile:  

     RDKit          2D

 40 43  0  0  1  0  0  0  0  0999 V2000
    4.2792   -6.7208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -7.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -7.0250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -6.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292   -6.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -7.6333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -5.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1917   -6.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8417   -6.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292   -6.1208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -5.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -7.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0292   -5.3583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917   -7.9333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917   -6.7250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6292   -5.2333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292   -7.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7917   -6.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0917   -6.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6667   -7.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0292   -5.6750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6667   -7.0333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6917   -6.9250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2792   -7.3250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9042   -6.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7042   -6.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7167   -5.8083    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8042   -4.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1417   -7.9125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6292   -4.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1917   -8.5333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0542   -5.0375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7792   -7.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -4.5875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0792   -4.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6792   -4.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8792   -5.2750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2292   -7.3250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6792   -6.5125    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1917   -4.7750    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  1  1  0
  5  2  1  0
  6 17  1  0
  7  4  1  0
  8  9  1  0
  9  1  1  0
 10 11  1  0
 11  4  1  0
 12  2  1  0
 13  7  1  0
 14  6  1  0
 15  3  1  0
 16 13  1  0
 17 12  1  0
  8 18  1  1
 19 18  1  0
 20 14  1  0
 21 16  2  0
 22 15  1  0
 23 19  2  0
  1 24  1  1
  2 25  1  6
  3 26  1  1
 27 10  1  0
 28 16  1  0
 29 20  1  0
 30 13  1  0
 31 14  1  0
 32 30  1  0
 33 19  1  0
 34 32  1  0
 35 34  1  0
 36 35  1  0
 37 35  1  0
  5 38  1  1
  7 39  1  1
 13 40  1  1
  8  7  1  0
  5 10  1  0
  6  3  1  0
 22 20  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2068985

   (2S)-2-[(8S,9S,10S,14S,16S,17R)-16-acetyloxy-3,11-dihydroxy-4,8,10,14-tetramethyl-1,2,3,4,5,6,7,9,11,12,13,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 520.75

Molecular Weight (Monoisotopic): 520.3764

AlogP: 5.68

#Rotatable Bonds: 7

Polar Surface Area: 104.06

Molecular Species: ACID

HBA: 5

HBD: 3

#RO5 Violations: 2

HBA (Lipinski): 6

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 4.61

CX Basic pKa: ┄

CX LogP: 4.94

CX LogD: 2.23

Aromatic Rings: ┄

Heavy Atoms: 37

QED Weighted: 0.37

Np Likeness Score: 2.59

References

1. Duvold T, Sørensen MD, Björkling F, Henriksen AS, Rastrup-Andersen N..  (2001)  Synthesis and conformational analysis of fusidic acid side chain derivatives in relation to antibacterial activity.,  44  (19): [PMID:11543681] [10.1021/jm010899a]

Source

Source(1):

• Scientific Literature