The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(4-(aminomethyl)phenyl)piperidin-4-yl)-1-(naphthalen-2-ylsulfonyl)piperidine-4-carboxamide ID: ALA206951
PubChem CID: 44411942
Max Phase: Preclinical
Molecular Formula: C28H34N4O3S
Molecular Weight: 506.67
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NCc1ccc(N2CCC(NC(=O)C3CCN(S(=O)(=O)c4ccc5ccccc5c4)CC3)CC2)cc1
Standard InChI: InChI=1S/C28H34N4O3S/c29-20-21-5-8-26(9-6-21)31-15-13-25(14-16-31)30-28(33)23-11-17-32(18-12-23)36(34,35)27-10-7-22-3-1-2-4-24(22)19-27/h1-10,19,23,25H,11-18,20,29H2,(H,30,33)
Standard InChI Key: WLPUOXSCELLULE-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-0.1910 -1.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6362 -1.4214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0599 -0.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6537 0.0098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1764 0.0176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5929 -0.6927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4179 -0.6846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8253 0.0345 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8849 -0.7223 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.2837 -1.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1051 -1.4603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5325 -0.7524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1285 -0.0304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3009 -0.0162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3575 -0.7662 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7561 -1.4880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5811 -1.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3338 -2.1961 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.9798 -2.2283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8010 -2.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2273 -1.5377 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8299 -0.8142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0024 -0.7968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.0521 -1.5545 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
8.0453 -2.3783 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.0453 -0.7282 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8770 -1.5735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2735 -2.2987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1269 -0.8854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3042 -0.8696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5254 -1.6122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0978 -2.3140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4884 -3.0349 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3102 -3.0553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7398 -2.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3430 -1.6307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16 18 2 0
17 19 1 0
3 9 1 0
9 10 1 0
4 5 1 0
2 3 1 0
5 6 2 0
17 23 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
6 1 1 0
21 24 1 0
1 2 2 0
24 25 2 0
9 14 1 0
24 26 2 0
10 11 1 0
24 27 1 0
11 12 1 0
27 28 2 0
28 32 1 0
12 13 1 0
31 29 1 0
13 14 1 0
29 30 2 0
30 27 1 0
6 7 1 0
12 15 1 0
31 32 1 0
3 4 2 0
32 33 2 0
15 16 1 0
33 34 1 0
7 8 1 0
34 35 2 0
16 17 1 0
35 36 1 0
36 31 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.67Molecular Weight (Monoisotopic): 506.2352AlogP: 3.48#Rotatable Bonds: 6Polar Surface Area: 95.74Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: 1HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.41CX LogP: 2.55CX LogD: 0.57Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.53Np Likeness Score: -1.61
References 1. Miyazaki Y, Kato Y, Manabe T, Shimada H, Mizuno M, Egusa T, Ohkouchi M, Shiromizu I, Matsusue T, Yamamoto I.. (2006) Synthesis and evaluation of 4-substituted benzylamine derivatives as beta-tryptase inhibitors., 16 (11): [PMID:16540315 ] [10.1016/j.bmcl.2006.02.064 ]