(R)-N-(4-(4-methoxyphenyl)thiazol-2-yl)-3,3-dimethyl-2-(4-methylphenylsulfonamido)butanamide

ID: ALA2070993

PubChem CID: 54765374

Max Phase: Preclinical

Molecular Formula: C23H27N3O4S2

Molecular Weight: 473.62

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2csc(NC(=O)[C@H](NS(=O)(=O)c3ccc(C)cc3)C(C)(C)C)n2)cc1

Standard InChI:  InChI=1S/C23H27N3O4S2/c1-15-6-12-18(13-7-15)32(28,29)26-20(23(2,3)4)21(27)25-22-24-19(14-31-22)16-8-10-17(30-5)11-9-16/h6-14,20,26H,1-5H3,(H,24,25,27)/t20-/m0/s1

Standard InChI Key:  UANFYVVHKDEOGE-FQEVSTJZSA-N

Molfile:  

     RDKit          2D

 32 34  0  0  0  0  0  0  0  0999 V2000
   -2.0583   -0.6167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4667   -1.3333    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6418   -1.3286    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1801   -0.9208    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1801   -0.0958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4675   -2.1594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1836   -2.5691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1851   -3.3934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4707   -3.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7532   -3.3918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7552   -2.5690    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4645    0.3146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7512   -0.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4620    1.1396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7464    1.5503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9663    1.2801    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4686    1.9381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9406    2.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7299    2.3749    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.3538    1.9193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7518    1.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5759    1.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0029    1.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5999    2.6108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7771    2.6235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8278    1.8713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2274    1.1495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8940    0.3177    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8928    1.1427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6091   -0.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6125    0.7333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4708   -4.6327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
  4  5  1  0
  8  9  2  0
  4  2  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
  9 10  1  0
  3  2  2  0
 20 21  2  0
 10 11  2  0
 21 22  1  0
 11  6  1  0
 22 23  2  0
  2  6  1  0
 23 24  1  0
  5 12  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 23 26  1  0
 12 13  2  0
 26 27  1  0
  6  7  2  0
  5 28  1  6
 12 14  1  0
 28 29  1  0
  2  1  2  0
 28 30  1  0
 14 15  1  0
 28 31  1  0
 15 16  2  0
  9 32  1  0
M  END

Associated Targets(Human)

KCNQ1 Tclin Voltage-gated potassium channel subunit Kv7.1 (147 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 473.62Molecular Weight (Monoisotopic): 473.1443AlogP: 4.46#Rotatable Bonds: 7
Polar Surface Area: 97.39Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.74CX Basic pKa: CX LogP: 5.28CX LogD: 5.13
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.53Np Likeness Score: -1.43

References

1. Mattmann ME, Yu H, Lin Z, Xu K, Huang X, Long S, Wu M, McManus OB, Engers DW, Le UM, Li M, Lindsley CW, Hopkins CR..  (2012)  Identification of (R)-N-(4-(4-methoxyphenyl)thiazol-2-yl)-1-tosylpiperidine-2-carboxamide, ML277, as a novel, potent and selective K(v)7.1 (KCNQ1) potassium channel activator.,  22  (18): [PMID:22910039] [10.1016/j.bmcl.2012.07.060]

Source