(R)-N-(4-(4-methoxyphenyl)thiazol-2-yl)-2-(4-methylphenylsulfonamido)propanamide

ID: ALA2070995

PubChem CID: 54765376

Max Phase: Preclinical

Molecular Formula: C20H21N3O4S2

Molecular Weight: 431.54

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2csc(NC(=O)[C@@H](C)NS(=O)(=O)c3ccc(C)cc3)n2)cc1

Standard InChI:  InChI=1S/C20H21N3O4S2/c1-13-4-10-17(11-5-13)29(25,26)23-14(2)19(24)22-20-21-18(12-28-20)15-6-8-16(27-3)9-7-15/h4-12,14,23H,1-3H3,(H,21,22,24)/t14-/m1/s1

Standard InChI Key:  SLDWMTDVBWFVSC-CQSZACIVSA-N

Molfile:  

     RDKit          2D

 29 31  0  0  0  0  0  0  0  0999 V2000
   16.6417   -0.9208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2333   -1.6375    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   17.0582   -1.6328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5199   -1.2250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.5199   -0.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2325   -2.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5164   -2.8733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5149   -3.6975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2293   -4.1119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9468   -3.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9448   -2.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2355    0.0104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9488   -0.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2380    0.8354    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9536    1.2461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7337    0.9760    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.2314    1.6339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7594    2.3106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9701    2.0708    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   19.0538    1.6152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4518    0.8912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2759    0.8750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.7029    1.5819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2999    2.3067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4771    2.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5278    1.5671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.9274    0.8453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8060    0.0135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2292   -4.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
 14 15  1  0
 15 16  2  0
  7  8  1  0
  4  5  1  0
  8  9  2  0
  4  2  1  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 15  1  0
  9 10  1  0
  3  2  2  0
 20 21  2  0
 10 11  2  0
 21 22  1  0
 11  6  1  0
 22 23  2  0
  2  6  1  0
 23 24  1  0
  5 12  1  0
 24 25  2  0
 25 20  1  0
 17 20  1  0
 23 26  1  0
 12 13  2  0
 26 27  1  0
  6  7  2  0
  5 28  1  6
 12 14  1  0
  9 29  1  0
M  END

Associated Targets(Human)

KCNQ1 Tclin Voltage-gated potassium channel subunit Kv7.1 (147 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.54Molecular Weight (Monoisotopic): 431.0973AlogP: 3.43#Rotatable Bonds: 7
Polar Surface Area: 97.39Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.75CX Basic pKa: CX LogP: 4.02CX LogD: 3.87
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.60Np Likeness Score: -1.96

References

1. Mattmann ME, Yu H, Lin Z, Xu K, Huang X, Long S, Wu M, McManus OB, Engers DW, Le UM, Li M, Lindsley CW, Hopkins CR..  (2012)  Identification of (R)-N-(4-(4-methoxyphenyl)thiazol-2-yl)-1-tosylpiperidine-2-carboxamide, ML277, as a novel, potent and selective K(v)7.1 (KCNQ1) potassium channel activator.,  22  (18): [PMID:22910039] [10.1016/j.bmcl.2012.07.060]

Source