(R)-1-tosyl-N-(4-(4-(trifluoromethoxy)phenyl)thiazol-2-yl)piperidine-2-carboxamide

ID: ALA2071005

PubChem CID: 56947233

Max Phase: Preclinical

Molecular Formula: C23H22F3N3O4S2

Molecular Weight: 525.57

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccc(S(=O)(=O)N2CCCC[C@@H]2C(=O)Nc2nc(-c3ccc(OC(F)(F)F)cc3)cs2)cc1

Standard InChI:  InChI=1S/C23H22F3N3O4S2/c1-15-5-11-18(12-6-15)35(31,32)29-13-3-2-4-20(29)21(30)28-22-27-19(14-34-22)16-7-9-17(10-8-16)33-23(24,25)26/h5-12,14,20H,2-4,13H2,1H3,(H,27,28,30)/t20-/m1/s1

Standard InChI Key:  LVEKCAQUUIXWME-HXUWFJFHSA-N

Molfile:  

     RDKit          2D

 35 38  0  0  0  0  0  0  0  0999 V2000
   -1.1042  -12.4333    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5125  -13.1500    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6877  -13.1453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6500  -11.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6500  -12.7375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9380  -13.1458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2260  -12.7375    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2260  -11.9125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9380  -11.4958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5133  -13.9760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2294  -14.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2309  -15.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5165  -15.6244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7991  -15.2085    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8011  -14.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5103  -11.5021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7970  -11.9167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5079  -10.6771    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7922  -10.2664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0121  -10.5365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4856   -9.8786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0136   -9.2019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7757   -9.4417    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.3080   -9.8973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7060  -10.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5300  -10.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9571   -9.9306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5541   -9.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7313   -9.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5166  -16.4494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7820   -9.9454    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2072   -9.2385    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0321   -9.2533    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8076   -8.5167    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.6125   -8.5208    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
 16 17  2  0
  8  9  1  0
 16 18  1  0
  7  2  1  0
 18 19  1  0
 19 20  2  0
  3  2  2  0
  2 10  1  0
  4  5  1  0
 10 11  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 19  1  0
 11 12  1  0
 24 25  2  0
  2  1  2  0
 25 26  1  0
 12 13  2  0
 26 27  2  0
  4  9  1  0
 27 28  1  0
 13 14  1  0
 28 29  2  0
 29 24  1  0
 21 24  1  0
  5  6  1  0
 13 30  1  0
 14 15  2  0
 27 31  1  0
 15 10  1  0
 31 32  1  0
  6  7  1  0
 32 33  1  0
  8 16  1  6
 32 34  1  0
  7  8  1  0
 32 35  1  0
M  END

Associated Targets(Human)

KCNQ1 Tclin Voltage-gated potassium channel subunit Kv7.1 (147 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 525.57Molecular Weight (Monoisotopic): 525.1004AlogP: 5.20#Rotatable Bonds: 6
Polar Surface Area: 88.60Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 7.75CX Basic pKa: CX LogP: 6.32CX LogD: 6.17
Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.48Np Likeness Score: -2.12

References

1. Mattmann ME, Yu H, Lin Z, Xu K, Huang X, Long S, Wu M, McManus OB, Engers DW, Le UM, Li M, Lindsley CW, Hopkins CR..  (2012)  Identification of (R)-N-(4-(4-methoxyphenyl)thiazol-2-yl)-1-tosylpiperidine-2-carboxamide, ML277, as a novel, potent and selective K(v)7.1 (KCNQ1) potassium channel activator.,  22  (18): [PMID:22910039] [10.1016/j.bmcl.2012.07.060]

Source