6'-Ocaffeoylgoodyeroside

ID: ALA2071306

PubChem CID: 70693126

Max Phase: Preclinical

Molecular Formula: C19H22O11

Molecular Weight: 426.37

Molecule Type: Small molecule

Names and Identifiers

Synonyms: 6'-Ocaffeoylgoodyeroside | CHEMBL2071306|6'-Ocaffeoylgoodyeroside|BDBM50389999

Canonical SMILES:  O=C(/C=C/c1ccc(O)c(O)c1)OC[C@H]1O[C@@H](O[C@@H]2COC(=O)C2)[C@H](O)[C@@H](O)[C@@H]1O

Standard InChI:  InChI=1S/C19H22O11/c20-11-3-1-9(5-12(11)21)2-4-14(22)28-8-13-16(24)17(25)18(26)19(30-13)29-10-6-15(23)27-7-10/h1-5,10,13,16-21,24-26H,6-8H2/b4-2+/t10-,13+,16+,17-,18+,19+/m0/s1

Standard InChI Key:  CYEFUTNNSBRMEB-ICCSCHITSA-N

Molfile:  

     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   -3.8267   -2.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8267   -3.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1140   -3.8309    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4015   -3.4204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4015   -2.5953    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1140   -2.1808    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6852   -2.1870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4088   -1.7704    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9713   -2.5998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9730   -3.4262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1888   -3.6856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2952   -3.0183    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1860   -2.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0633   -4.4710    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6870   -3.8360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5412   -3.8360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1140   -4.6559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5430   -2.1870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5454   -1.3620    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8316   -0.9453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8340   -0.1202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1152   -1.3578    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1201    0.2922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1225    1.1173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4084    1.5317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4105    2.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1273    2.7651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8434    2.3482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8379    1.5252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6964    2.7681    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1308    3.5901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4 15  1  6
  1  2  1  0
  2 16  1  6
  5  8  1  6
  3 17  1  1
  1  6  1  0
  1 18  1  1
  9  7  1  6
 18 19  1  0
  9 10  1  0
 19 20  1  0
  2  3  1  0
 20 21  1  0
  3  4  1  0
 20 22  2  0
  4  5  1  0
 21 23  2  0
  5  6  1  0
 23 24  1  0
 10 11  1  0
 24 25  2  0
 11 12  1  0
 25 26  1  0
 12 13  1  0
 26 27  2  0
  9 13  1  0
 27 28  1  0
 28 29  2  0
 29 24  1  0
 11 14  2  0
 26 30  1  0
  5  7  1  0
 27 31  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA2071306

   6'-Ocaffeoylgoodyeroside

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 426.37

Molecular Weight (Monoisotopic): 426.1162

AlogP: -1.21

#Rotatable Bonds: 6

Polar Surface Area: 172.21

Molecular Species: NEUTRAL

HBA: 11

HBD: 5

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 5

#RO5 Violations (Lipinski): 1

CX Acidic pKa: 9.21

CX Basic pKa: ┄

CX LogP: -0.11

CX LogD: -0.12

Aromatic Rings: 1

Heavy Atoms: 30

QED Weighted: 0.21

Np Likeness Score: 2.00

References

1. Muhammad A, Guerrero-Analco JA, Martineau LC, Musallam L, Madiraju P, Nachar A, Saleem A, Haddad PS, Arnason JT..  (2012)  Antidiabetic compounds from Sarracenia purpurea used traditionally by the Eeyou Istchee Cree First Nation.,  75  (7): [PMID:22738356] [10.1021/np3001317]

Source

Source(1):

• Scientific Literature