The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(hydroxydiphenylmethyl)piperidin-1-yl)-1-p-tolylbutan-1-one ID: ALA207278
PubChem CID: 15230929
Max Phase: Preclinical
Molecular Formula: C29H33NO2
Molecular Weight: 427.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cc1ccc(C(=O)CCCN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)cc1
Standard InChI: InChI=1S/C29H33NO2/c1-23-14-16-24(17-15-23)28(31)13-8-20-30-21-18-27(19-22-30)29(32,25-9-4-2-5-10-25)26-11-6-3-7-12-26/h2-7,9-12,14-17,27,32H,8,13,18-22H2,1H3
Standard InChI Key: ASQUTXZYOFTTDB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-4.9625 -4.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1375 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3125 -4.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1375 -3.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1375 -4.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4228 -2.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4224 -1.9365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1374 -1.5232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8543 -1.9401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8511 -2.7630 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8522 -5.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8526 -6.0635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1376 -6.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4207 -6.0599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4239 -5.2370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9012 -4.7163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0798 -4.7183 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6635 -4.0056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0747 -3.2893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9024 -3.2857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8385 -4.0087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4287 -4.7248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3963 -4.7279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8061 -5.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6311 -5.4470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3909 -6.1568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.0367 -6.1653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8610 -6.1688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2770 -5.4553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8628 -4.7369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0399 -4.7370 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1020 -5.4573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 16 1 0
7 8 2 0
8 9 1 0
2 5 1 0
9 10 2 0
3 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
10 4 1 0
18 21 1 0
2 3 1 0
21 22 1 0
5 11 2 0
22 23 1 0
4 6 2 0
23 24 1 0
11 12 1 0
24 25 1 0
1 2 1 0
24 26 2 0
12 13 2 0
25 27 2 0
6 7 1 0
27 28 1 0
13 14 1 0
28 29 2 0
2 4 1 0
29 30 1 0
14 15 2 0
30 31 2 0
31 25 1 0
15 5 1 0
29 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 427.59Molecular Weight (Monoisotopic): 427.2511AlogP: 5.61#Rotatable Bonds: 8Polar Surface Area: 40.54Molecular Species: NEUTRALHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.22CX Basic pKa: 8.41CX LogP: 5.53CX LogD: 4.48Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -0.66
References 1. Lafite P, Dijols S, Buisson D, Macherey AC, Zeldin DC, Dansette PM, Mansuy D.. (2006) Design and synthesis of selective, high-affinity inhibitors of human cytochrome P450 2J2., 16 (10): [PMID:16495056 ] [10.1016/j.bmcl.2006.02.004 ]