The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-(4-(hydroxydiphenylmethyl)piperidin-1-yl)-1-(4-(2-hydroxyethyl)phenyl)butan-1-one ID: ALA207389
PubChem CID: 44411159
Max Phase: Preclinical
Molecular Formula: C30H35NO3
Molecular Weight: 457.61
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CCCN1CCC(C(O)(c2ccccc2)c2ccccc2)CC1)c1ccc(CCO)cc1
Standard InChI: InChI=1S/C30H35NO3/c32-23-19-24-13-15-25(16-14-24)29(33)12-7-20-31-21-17-28(18-22-31)30(34,26-8-3-1-4-9-26)27-10-5-2-6-11-27/h1-6,8-11,13-16,28,32,34H,7,12,17-23H2
Standard InChI Key: AOVFGEQZHDTSQA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
7.0250 -16.5333 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8500 -16.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6750 -16.5333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8500 -15.7083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8500 -17.3583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5647 -15.2941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5651 -14.4699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8501 -14.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1332 -14.4735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1364 -15.2963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1353 -17.7726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1349 -18.5968 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8499 -19.0101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5668 -18.5932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5636 -17.7703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0863 -17.2496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9077 -17.2516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3240 -16.5390 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.9128 -15.8227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0851 -15.8190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1490 -16.5421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5588 -17.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3838 -17.2612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.7936 -17.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6186 -17.9804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3784 -18.6902 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.0242 -18.6986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8485 -18.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.2645 -17.9886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.8503 -17.2702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0274 -17.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0895 -17.9907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.5002 -18.7062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.3252 -18.7082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8 9 1 0
2 5 1 0
9 10 2 0
3 20 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
10 4 1 0
18 21 1 0
2 3 1 0
21 22 1 0
5 11 2 0
22 23 1 0
4 6 2 0
23 24 1 0
11 12 1 0
24 25 1 0
1 2 1 0
24 26 2 0
12 13 2 0
25 27 2 0
6 7 1 0
27 28 1 0
13 14 1 0
28 29 2 0
2 4 1 0
29 30 1 0
14 15 2 0
30 31 2 0
31 25 1 0
15 5 1 0
29 32 1 0
3 16 1 0
32 33 1 0
7 8 2 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 457.61Molecular Weight (Monoisotopic): 457.2617AlogP: 4.83#Rotatable Bonds: 10Polar Surface Area: 60.77Molecular Species: NEUTRALHBA: 4HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.22CX Basic pKa: 8.41CX LogP: 4.54CX LogD: 3.50Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -0.40
References 1. Lafite P, Dijols S, Buisson D, Macherey AC, Zeldin DC, Dansette PM, Mansuy D.. (2006) Design and synthesis of selective, high-affinity inhibitors of human cytochrome P450 2J2., 16 (10): [PMID:16495056 ] [10.1016/j.bmcl.2006.02.004 ]