Glycolithocholate-3-sulfate

ID: ALA2074584

Cas Number: 15324-64-8

PubChem CID: 72222

Product Number: G651234, Order Now?

Max Phase: Preclinical

Molecular Formula: C26H43NO7S

Molecular Weight: 513.70

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](OS(=O)(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C26H43NO7S/c1-16(4-9-23(28)27-15-24(29)30)20-7-8-21-19-6-5-17-14-18(34-35(31,32)33)10-12-25(17,2)22(19)11-13-26(20,21)3/h16-22H,4-15H2,1-3H3,(H,27,28)(H,29,30)(H,31,32,33)/t16-,17-,18-,19+,20-,21+,22+,25+,26-/m1/s1

Standard InChI Key:  FHXBAFXQVZOILS-OETIFKLTSA-N

Molfile:  

     RDKit          2D

 40 43  0  0  0  0  0  0  0  0999 V2000
   -5.0605    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7750    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4895    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4895   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7750   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0605   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3460    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6316    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6316   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3460   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3460    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6316    1.6501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9171    1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9171    0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1325    0.1577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6476    0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1325    1.4925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0605    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0605   -1.8250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2040   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2120    0.9125    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7656   -0.5000    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8125   -0.5819    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9171    2.0626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8775    2.2771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4296    2.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0706    2.4486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6581    1.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1669    1.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5794    1.0197    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5794    2.4486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4044    1.0197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8169    0.3052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6419    0.3052    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4044   -0.4092    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0290   -1.2375    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8540   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0290   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -8.0290   -2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1448    1.6489    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
 10  6  1  0
  6  1  1  0
  1  7  1  0
  8  9  1  0
  9 10  1  0
  7 11  1  0
  8  7  1  0
 14  8  1  0
 11 12  1  0
 12 13  1  0
 13 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 17 16  1  0
  1 18  1  1
  6 19  1  1
  4 20  1  6
  7 21  1  6
  8 22  1  1
 14 23  1  6
 13 24  1  1
 17 25  1  0
 25 26  1  6
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 20 36  1  0
 36 37  2  0
 36 38  2  0
 36 39  1  0
 17 40  1  6
M  END

Alternative Forms

1. Parent:

   

   ALA2074584

   Glycolithocholic acid 3-sulfate

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 513.70

Molecular Weight (Monoisotopic): 513.2760

AlogP: 4.45

#Rotatable Bonds: 8

Polar Surface Area: 130.00

Molecular Species: ACID

HBA: 5

HBD: 3

#RO5 Violations: 1

HBA (Lipinski): 8

HBD (Lipinski): 3

#RO5 Violations (Lipinski): 1

CX Acidic pKa: -1.10

CX Basic pKa: ┄

CX LogP: 2.64

CX LogD: -1.68

Aromatic Rings: ┄

Heavy Atoms: 35

QED Weighted: 0.41

Np Likeness Score: 1.79

References

1. Chen ZS, Hopper-Borge E, Belinsky MG, Shchaveleva I, Kotova E, Kruh GD..  (2003)  Characterization of the transport properties of human multidrug resistance protein 7 (MRP7, ABCC10).,  63  (1): [PMID:12527806] [10.1124/mol.63.2.351]

2. Zelcer N, Saeki T, Bot I, Kuil A, Borst P..  (2003)  Transport of bile acids in multidrug-resistance-protein 3-overexpressing cells co-transfected with the ileal Na+-dependent bile-acid transporter.,  369  (1): [PMID:12220224] [10.1042/bj20021081]

3. Zelcer N, Reid G, Wielinga P, Kuil A, van der Heijden I, Schuetz JD, Borst P..  (2003)  Steroid and bile acid conjugates are substrates of human multidrug-resistance protein (MRP) 4 (ATP-binding cassette C4).,  371  (1): [PMID:12523936] [10.1042/bj20021886]

4. Loe DW, Almquist KC, Cole SP, Deeley RG..  (1996)  ATP-dependent 17 beta-estradiol 17-(beta-D-glucuronide) transport by multidrug resistance protein (MRP). Inhibition by cholestatic steroids.,  271  (1): [PMID:8621644] [10.1074/jbc.271.16.9683]

Source

Source(1):

• TP-search Transporter Database