Estradiol glucuronide sulfate

ID: ALA2074585

PubChem CID: 5281895

Max Phase: Preclinical

Molecular Formula: C24H32O11S

Molecular Weight: 528.58

Molecule Type: Small molecule

Names and Identifiers

Synonyms: Estradiol glucuronide sulfate | 17-beta-estradiol 3-sulfate-17-(beta-D-glucuronide)|CHEBI:792|CHEMBL2074585|ESTRADIOL GLUCURONIDE SULFATE|17beta-estradiol 3-sulfate 17-(beta-D-glucosiduronic acid)|Estradiol 17beta-glucuronide 3-sulfate|BDBM50420220|LMST05010035|(2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[[(8R,9S,13S,14S,17S)-13-methyl-3-sulfooxy-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]oxy]oxane-2-carboxylic acid|17beta-estradiol 3-sulfate-17-(beta-D-glucuronoside)|Q27105359|17Show More⌵

Canonical SMILES:  C[C@]12CC[C@@H]3c4ccc(OS(=O)(=O)O)cc4CC[C@H]3[C@@H]1CC[C@@H]2O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O

Standard InChI:  InChI=1S/C24H32O11S/c1-24-9-8-14-13-5-3-12(35-36(30,31)32)10-11(13)2-4-15(14)16(24)6-7-17(24)33-23-20(27)18(25)19(26)21(34-23)22(28)29/h3,5,10,14-21,23,25-27H,2,4,6-9H2,1H3,(H,28,29)(H,30,31,32)/t14-,15-,16+,17+,18+,19+,20-,21+,23-,24+/m1/s1

Standard InChI Key:  VRMSCBRLZUCJBX-QXYWQCSFSA-N

Molfile:  

     RDKit          2D

 39 43  0  0  0  0  0  0  0  0999 V2000
   -3.2116    2.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9261    1.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9261    1.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2116    0.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4971    1.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4971    1.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7826    2.2393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0681    1.8268    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0681    1.0018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7826    0.5893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7827    3.0643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0682    3.4769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3537    3.0644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3537    2.2394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4309    1.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9158    2.6519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4309    3.3193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6858    4.1039    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4827    4.3175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0661    3.7341    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8630    3.9476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0765    4.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4932    5.3279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6963    5.1143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4464    3.3643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2432    3.5778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2328    2.5674    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8734    4.9580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7067    6.1248    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1129    5.6977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3537    3.8894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0681    2.6518    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3537    1.4144    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7826    1.4143    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6406    0.5893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4375    0.8028    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0209    0.2195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1520    1.2153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2240    1.5997    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  6  2  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  6  7  1  0
  5  6  1  0
 10  5  1  0
  8  9  1  0
  9 10  1  0
  7 11  1  0
  8  7  1  0
 14  8  1  0
 11 12  1  0
 12 13  1  0
 13 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  1
 19 18  1  1
 19 20  1  0
 24 19  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 21 25  1  1
 25 26  1  0
 25 27  2  0
 22 28  1  6
 23 29  1  1
 24 30  1  6
 13 31  1  1
  8 32  1  1
 14 33  1  6
  7 34  1  6
  3 35  1  0
 35 36  1  0
 36 37  1  0
 36 38  2  0
 36 39  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA2074585

   ESTRADIOL GLUCURONIDE SULFATE

Molecule Features

Natural Product: Yes

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 528.58

Molecular Weight (Monoisotopic): 528.1665

AlogP: 1.00

#Rotatable Bonds: 5

Polar Surface Area: 180.05

Molecular Species: ACID

HBA: 9

HBD: 5

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 5

#RO5 Violations (Lipinski): 2

CX Acidic pKa: -1.75

CX Basic pKa: ┄

CX LogP: 0.16

CX LogD: -3.89

Aromatic Rings: 1

Heavy Atoms: 36

QED Weighted: 0.34

Np Likeness Score: 1.87

References

1. Ohtsuki S, Kikkawa T, Mori S, Hori S, Takanaga H, Otagiri M, Terasaki T..  (2004)  Mouse reduced in osteosclerosis transporter functions as an organic anion transporter 3 and is localized at abluminal membrane of blood-brain barrier.,  309  (1): [PMID:14762099] [10.1124/jpet.103.063370]

2. Chen ZS, Hopper-Borge E, Belinsky MG, Shchaveleva I, Kotova E, Kruh GD..  (2003)  Characterization of the transport properties of human multidrug resistance protein 7 (MRP7, ABCC10).,  63  (1): [PMID:12527806] [10.1124/mol.63.2.351]

3. Loe DW, Almquist KC, Cole SP, Deeley RG..  (1996)  ATP-dependent 17 beta-estradiol 17-(beta-D-glucuronide) transport by multidrug resistance protein (MRP). Inhibition by cholestatic steroids.,  271  (1): [PMID:8621644] [10.1074/jbc.271.16.9683]

4. Tamai I, Nozawa T, Koshida M, Nezu J, Sai Y, Tsuji A..  (2001)  Functional characterization of human organic anion transporting polypeptide B (OATP-B) in comparison with liver-specific OATP-C.,  18  (1): [PMID:11683238] [10.1023/a:1013077609227]

Source

Source(1):

• TP-search Transporter Database