N-retinyl-N-retinylidene ethanolamine

ID: ALA2074656

Cas Number: 653573-74-1

PubChem CID: 70695226

Max Phase: Preclinical

Molecular Formula: C42H58ClNO

Molecular Weight: 592.93

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1=C(/C=C/C(C)=C/C=C/C(C)=C/c2cc(/C=C/C=C(C)/C=C/C3=C(C)CCCC3(C)C)cc[n+]2CCO)C(C)(C)CCC1.[Cl-]

Standard InChI:  InChI=1S/C42H58NO.ClH/c1-32(20-22-39-35(4)17-12-25-41(39,6)7)14-10-16-34(3)30-38-31-37(24-27-43(38)28-29-44)19-11-15-33(2)21-23-40-36(5)18-13-26-42(40,8)9;/h10-11,14-16,19-24,27,30-31,44H,12-13,17-18,25-26,28-29H2,1-9H3;1H/q+1;/p-1/b16-10+,19-11+,22-20+,23-21+,32-14+,33-15+,34-30+;

Standard InChI Key:  CQPMPGJOKFUPJS-KFKWWMHDSA-M

Molfile:  

     RDKit          2D

 45 46  0  0  0  0  0  0  0  0999 V2000
   -4.8911    0.1473    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -2.5266    1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2411    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9555    1.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9556    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2411    0.6187    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5266    1.0313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2411    3.0937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5266    3.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5266    4.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8121    4.7437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8121    5.5687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0977    4.3312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0977    5.9812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0977    6.8062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3832    7.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3832    8.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0977    8.4563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8121    8.0438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8121    7.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5266    6.8063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0293    6.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4418    7.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8121    0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2411   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5266   -0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5266   -1.4437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0977    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3832    0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0976    1.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3313    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0458    0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7602    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4747    0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7602    1.8562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1892    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9036    0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9036   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6181   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3326   -0.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3326    0.6187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6181    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2056    1.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0306    1.7457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1892   -0.6188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  2  1  0
  3  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 11 13  1  0
 12 14  2  0
 14 15  1  0
 15 16  1  0
 20 15  2  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 16 22  1  0
 16 23  1  0
  7 24  1  0
  6 25  1  0
 25 26  1  0
 26 27  1  0
 24 28  2  0
 28 29  1  0
 28 30  1  0
 29 31  2  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 33 35  1  0
 34 36  2  0
 36 37  1  0
 37 38  2  0
 42 37  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 42 44  1  0
 38 45  1  0
M  CHG  2   1  -1   6   1
M  END

Associated Targets(non-human)

Slco1a4 Solute carrier organic anion transporter family member 1A4 (114 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 592.93Molecular Weight (Monoisotopic): 592.4513AlogP: 11.00#Rotatable Bonds: 11
Polar Surface Area: 24.11Molecular Species: NEUTRALHBA: 1HBD: 1
#RO5 Violations: 2HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 5.56CX LogD: 5.56
Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.20Np Likeness Score: 1.07

References

1. Gao B, Wenzel A, Grimm C, Vavricka SR, Benke D, Meier PJ, Remè CE..  (2002)  Localization of organic anion transport protein 2 in the apical region of rat retinal pigment epithelium.,  43  (1): [PMID:11818398]