The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-retinyl-N-retinylidene ethanolamine ID: ALA2074656
Cas Number: 653573-74-1
PubChem CID: 70695226
Max Phase: Preclinical
Molecular Formula: C42H58ClNO
Molecular Weight: 592.93
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC1=C(/C=C/C(C)=C/C=C/C(C)=C/c2cc(/C=C/C=C(C)/C=C/C3=C(C)CCCC3(C)C)cc[n+]2CCO)C(C)(C)CCC1.[Cl-]
Standard InChI: InChI=1S/C42H58NO.ClH/c1-32(20-22-39-35(4)17-12-25-41(39,6)7)14-10-16-34(3)30-38-31-37(24-27-43(38)28-29-44)19-11-15-33(2)21-23-40-36(5)18-13-26-42(40,8)9;/h10-11,14-16,19-24,27,30-31,44H,12-13,17-18,25-26,28-29H2,1-9H3;1H/q+1;/p-1/b16-10+,19-11+,22-20+,23-21+,32-14+,33-15+,34-30+;
Standard InChI Key: CQPMPGJOKFUPJS-KFKWWMHDSA-M
Molfile:
RDKit 2D
45 46 0 0 0 0 0 0 0 0999 V2000
-4.8911 0.1473 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.5266 1.8563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2411 2.2687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9555 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9556 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2411 0.6187 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5266 1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2411 3.0937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5266 3.5062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5266 4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8121 4.7437 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8121 5.5687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0977 4.3312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0977 5.9812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0977 6.8062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3832 7.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3832 8.0438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0977 8.4563 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8121 8.0438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8121 7.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5266 6.8063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0293 6.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4418 7.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8121 0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2411 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5266 -0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5266 -1.4437 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0977 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3832 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0976 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3313 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0458 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7602 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4747 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7602 1.8562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1892 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9036 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9036 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6181 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3326 -0.2063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3326 0.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6181 1.0312 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2056 1.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0306 1.7457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1892 -0.6188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
3 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
11 13 1 0
12 14 2 0
14 15 1 0
15 16 1 0
20 15 2 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
16 22 1 0
16 23 1 0
7 24 1 0
6 25 1 0
25 26 1 0
26 27 1 0
24 28 2 0
28 29 1 0
28 30 1 0
29 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
33 35 1 0
34 36 2 0
36 37 1 0
37 38 2 0
42 37 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
42 43 1 0
42 44 1 0
38 45 1 0
M CHG 2 1 -1 6 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.93Molecular Weight (Monoisotopic): 592.4513AlogP: 11.00#Rotatable Bonds: 11Polar Surface Area: 24.11Molecular Species: NEUTRALHBA: 1HBD: 1#RO5 Violations: 2HBA (Lipinski): 2HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 5.56CX LogD: 5.56Aromatic Rings: 1Heavy Atoms: 44QED Weighted: 0.20Np Likeness Score: 1.07
References 1. Gao B, Wenzel A, Grimm C, Vavricka SR, Benke D, Meier PJ, Remè CE.. (2002) Localization of organic anion transport protein 2 in the apical region of rat retinal pigment epithelium., 43 (1): [PMID:11818398 ]