XR9051

ID: ALA2074789

PubChem CID: 70686866

Max Phase: Preclinical

Molecular Formula: C39H41ClN4O5

Molecular Weight: 644.77

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cc2c(cc1OC)CN(CCc1ccc(NC(=O)c3cccc(CC4NC(=O)/C(=C/c5ccccc5)N(C)C4=O)c3)cc1)CC2.Cl

Standard InChI:  InChI=1S/C39H40N4O5.ClH/c1-42-34(22-27-8-5-4-6-9-27)38(45)41-33(39(42)46)21-28-10-7-11-30(20-28)37(44)40-32-14-12-26(13-15-32)16-18-43-19-17-29-23-35(47-2)36(48-3)24-31(29)25-43;/h4-15,20,22-24,33H,16-19,21,25H2,1-3H3,(H,40,44)(H,41,45);1H/b34-22-;

Standard InChI Key:  LYQQSKCCHNEAQE-FXPPGXDZSA-N

Molfile:  

     RDKit          2D

 49 53  0  0  0  0  0  0  0  0999 V2000
   -2.8875   -2.2982    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  -10.7839   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4984   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.4984   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7839   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0694   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.0694   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3550   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6405   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9260   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2115   -1.6500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2115   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9260   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6405   -0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4970   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9260    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9260   -2.8875    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -9.3550   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7826   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7826   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0681   -2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3536   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3536   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0681   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6391   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9247   -0.8250    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6391    0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2102   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4957   -0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7812   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7813    0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4957    0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2102    0.4126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0668    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0668    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7813    2.0625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7813    2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4958    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2102    2.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2102    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4957    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9247    3.3001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9247    4.1251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2103    4.5375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4958    4.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6392    4.5376    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6392    5.3626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2102    5.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4958    5.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  2  7  2  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 14  9  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  0
 13 16  2  0
 10 17  2  0
 14 18  1  0
 15 19  1  0
 19 20  1  0
 19 24  2  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 25 27  2  0
 26 28  1  0
 28 29  1  0
 28 33  2  0
 29 30  2  0
 30 31  1  0
 31 32  2  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 41 36  1  0
 37 38  1  0
 39 40  1  0
 40 41  1  0
 39 42  1  0
 38 39  2  0
 45 38  1  0
 42 43  2  0
 43 44  1  0
 44 45  2  0
 43 46  1  0
 46 47  1  0
 44 48  1  0
 48 49  1  0
M  END

Associated Targets(non-human)

Abcb1a P-glycoprotein 3 (492 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 644.77Molecular Weight (Monoisotopic): 644.2999AlogP: 5.10#Rotatable Bonds: 10
Polar Surface Area: 100.21Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.27CX Basic pKa: 8.36CX LogP: 5.14CX LogD: 4.13
Aromatic Rings: 4Heavy Atoms: 48QED Weighted: 0.23Np Likeness Score: -0.39

References

1. Dale IL, Tuffley W, Callaghan R, Holmes JA, Martin K, Luscombe M, Mistry P, Ryder H, Stewart AJ, Charlton P, Twentyman PR, Bevan P..  (1998)  Reversal of P-glycoprotein-mediated multidrug resistance by XR9051, a novel diketopiperazine derivative.,  78  (1): [PMID:9764579] [10.1038/bjc.1998.597]