The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
16alpha,17beta-Estriol 16-(beta-D-glucuronide) ID: ALA2074802
Cas Number: 1852-50-2
PubChem CID: 122281
Product Number: E353152, Order Now?
Max Phase: Preclinical
Molecular Formula: C24H32O9
Molecular Weight: 464.51
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1C[C@@H](O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)[C@@H]2O
Standard InChI: InChI=1S/C24H32O9/c1-24-7-6-13-12-5-3-11(25)8-10(12)2-4-14(13)15(24)9-16(21(24)29)32-23-19(28)17(26)18(27)20(33-23)22(30)31/h3,5,8,13-21,23,25-29H,2,4,6-7,9H2,1H3,(H,30,31)/t13-,14-,15+,16-,17+,18+,19-,20+,21+,23-,24+/m1/s1
Standard InChI Key: FQYGGFDZJFIDPU-JRSYHJKYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-6.2980 -2.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0125 -2.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7270 -2.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7270 -3.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.0125 -3.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2980 -3.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5835 -2.2393 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8691 -2.6518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8691 -3.4768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5835 -3.8893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5835 -1.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8691 -1.0017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1546 -1.4142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1546 -2.2392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3700 -2.4941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8851 -1.8267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3700 -1.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0601 -1.8267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4767 -2.4101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2392 -3.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6517 -2.4101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8892 -3.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4767 -3.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6517 -3.8390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5858 -3.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9983 -3.8390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9983 -2.4100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2392 -4.5535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8892 -4.5535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7142 -3.1245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1150 -0.3747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1546 -0.5892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1546 -3.0642 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.8691 -1.8268 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-5.5835 -3.0643 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-8.4415 -3.8893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
10 6 1 0
6 1 2 0
1 7 1 0
8 9 1 0
9 10 1 0
7 11 1 0
8 7 1 0
14 8 1 0
11 12 1 0
12 13 1 0
13 17 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 1 6
19 18 1 6
21 19 1 0
19 22 1 0
20 21 1 0
22 23 1 0
23 24 1 0
24 20 1 0
20 25 1 6
25 26 2 0
25 27 1 0
24 28 1 1
23 29 1 6
22 30 1 1
17 31 1 1
13 32 1 1
14 33 1 6
8 34 1 1
7 35 1 6
4 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 464.51Molecular Weight (Monoisotopic): 464.2046AlogP: 0.50#Rotatable Bonds: 3Polar Surface Area: 156.91Molecular Species: ACIDHBA: 8HBD: 6#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.46CX Basic pKa: ┄CX LogP: 1.22CX LogD: -2.17Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: 2.24
References 1. Chen ZS, Hopper-Borge E, Belinsky MG, Shchaveleva I, Kotova E, Kruh GD.. (2003) Characterization of the transport properties of human multidrug resistance protein 7 (MRP7, ABCC10)., 63 (1): [PMID:12527806 ] [10.1124/mol.63.2.351 ] 2. Sneitz N, Vahermo M, Mosorin J, Laakkonen L, Poirier D, Finel M.. (2013) Regiospecificity and stereospecificity of human UDP-glucuronosyltransferases in the glucuronidation of estriol, 16-epiestriol, 17-epiestriol, and 13-epiestradiol., 41 (3): [PMID:23288867 ] [10.1124/dmd.112.049072 ]