UDC-L-NBD

ID: ALA2074811

PubChem CID: 70688932

Max Phase: Preclinical

Molecular Formula: C36H55N5O8

Molecular Weight: 685.86

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(CCC(=O)NC(CCCCNc1ccc([N+](=O)[O-])c2nonc12)COO)[C@H]1CC[C@H]2[C@@H]3[C@H](O)CC4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C36H55N5O8/c1-21(25-8-9-26-32-27(14-16-36(25,26)3)35(2)15-13-24(42)18-22(35)19-30(32)43)7-12-31(44)38-23(20-48-47)6-4-5-17-37-28-10-11-29(41(45)46)34-33(28)39-49-40-34/h10-11,21-27,30,32,37,42-43,47H,4-9,12-20H2,1-3H3,(H,38,44)/t21?,22?,23?,24-,25-,26+,27+,30-,32+,35+,36-/m1/s1

Standard InChI Key:  QLUQJGVHFRKZQO-NFQQRDPJSA-N

Molfile:  

     RDKit          2D

 52 57  0  0  0  0  0  0  0  0999 V2000
   -6.2685   -0.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9830   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6975   -0.7072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6975   -1.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9830   -1.9446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2686   -1.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5541   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8396   -0.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8396   -1.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5541   -1.9446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5541    0.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8396    0.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1252    0.5304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1251   -0.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3406   -0.5495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8556    0.1180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3405    0.7854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1252    1.3554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1251   -1.9446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1251   -1.1196    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8396    0.1179    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5541   -1.1196    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2685    0.1179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.4120   -1.9447    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0856    1.5700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6376    2.1831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2786    1.7415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6952    1.1581    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8984    1.3717    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3150    0.7883    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6848    2.1685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3995    0.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3995   -0.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1139    0.7883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8284    0.3758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5429    0.7883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1139   -0.8617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1139   -1.6867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8284   -2.0992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8284   -2.9242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8284   -3.7492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1140   -4.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1140   -4.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8284   -5.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5429   -4.9867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5429   -4.1617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3294   -5.2417    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1556   -4.5742    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3293   -3.9068    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8284   -6.2242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5429   -6.6367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1139   -6.6367    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
 10  6  1  0
  6  1  1  0
  1  7  1  0
  8  9  1  0
  9 10  1  0
 14  8  1  0
  8  7  1  0
  7 11  1  0
 11 12  1  0
 12 13  1  0
 13 17  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 13 18  1  1
  9 19  1  6
 14 20  1  6
  8 21  1  1
  7 22  1  6
  1 23  1  1
  4 24  1  6
 17 25  1  1
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  2  0
 30 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 33 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 46 41  2  0
 43 44  1  0
 44 45  2  0
 45 46  1  0
 42 49  2  0
 42 43  1  0
 43 47  2  0
 47 48  1  0
 48 49  1  0
 44 50  1  0
 50 51  2  0
 50 52  1  0
M  CHG  2  50   1  52  -1
M  END

Associated Targets(Human)

ABCC2 Tchem Canalicular multispecific organic anion transporter 1 (1191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 685.86Molecular Weight (Monoisotopic): 685.4051AlogP: 6.09#Rotatable Bonds: 14
Polar Surface Area: 193.11Molecular Species: NEUTRALHBA: 11HBD: 5
#RO5 Violations: 3HBA (Lipinski): 13HBD (Lipinski): 5#RO5 Violations (Lipinski): 3
CX Acidic pKa: 11.74CX Basic pKa: 0.25CX LogP: 4.54CX LogD: 4.54
Aromatic Rings: 2Heavy Atoms: 49QED Weighted: 0.07Np Likeness Score: 0.81

References

1. Cantz T, Nies AT, Brom M, Hofmann AF, Keppler D..  (2000)  MRP2, a human conjugate export pump, is present and transports fluo 3 into apical vacuoles of Hep G2 cells.,  278  (1): [PMID:10762605] [10.1152/ajpgi.2000.278.4.g522]
2. Jedlitschky, G G and 5 more authors.  1997-10-01  ATP-dependent transport of bilirubin glucuronides by the multidrug resistance protein MRP1 and its hepatocyte canalicular isoform MRP2.  [PMID:9355767]