Glutathione-methylfluorescein

ID: ALA2074816

PubChem CID: 70697258

Max Phase: Preclinical

Molecular Formula: C31H29N3O11S

Molecular Weight: 651.65

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: Glutathione-methylfluorescein | Glutathione-methylfluorescein|CHEMBL2074816

Canonical SMILES:  N[C@@H](CCC(=O)N[C@H](CSCc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1)C(=O)NCC(=O)O)C(=O)O

Standard InChI:  InChI=1S/C31H29N3O11S/c32-22(31(43)44)7-8-26(37)34-23(29(40)33-12-27(38)39)14-46-13-15-1-4-18(21(9-15)30(41)42)28-19-5-2-16(35)10-24(19)45-25-11-17(36)3-6-20(25)28/h1-6,9-11,22-23,35H,7-8,12-14,32H2,(H,33,40)(H,34,37)(H,38,39)(H,41,42)(H,43,44)/t22-,23+/m0/s1

Standard InChI Key:  LDNATPWUBRLWGH-XZOQPEGZSA-N

Molfile:  

     RDKit          2D

 46 49  0  0  0  0  0  0  0  0999 V2000
    1.7929    0.7480    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.7929   -0.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5074   -0.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5074   -1.3145    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219   -0.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9364   -0.4895    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219    0.7480    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6508   -0.0770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3653   -0.4895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0798   -0.0770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3653   -1.3145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7929   -1.7270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7929   -2.5520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0785   -1.3145    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0785   -2.9645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0785   -3.7895    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2816   -4.0030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7330   -4.2917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0681   -4.7999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3018   -3.4197    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0784    1.1605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0784    1.9855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7929    2.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7929    3.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0784    3.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3639    3.2230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3639    2.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5074    3.6355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5074    5.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219    3.2230    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0784    5.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7929    5.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7929    6.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0784    6.9060    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3640    6.4935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3640    5.6685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5074    6.9060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219    6.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2219    5.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3505    6.9061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0650    6.4936    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0650    5.6686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3505    5.2561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5074    4.4605    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9363    6.9061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7795    6.9061    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  6
  3  4  1  0
  3  5  1  0
  5  6  1  0
  5  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  2  0
  4 12  1  0
 12 13  1  0
 12 14  2  0
 13 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  6
 17 19  1  0
 17 20  2  0
  1 21  1  0
 21 22  1  0
 22 23  1  0
 22 27  2  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 24 28  1  0
 28 30  1  0
 25 31  1  0
 31 32  1  0
 36 31  2  0
 33 34  1  0
 34 35  1  0
 29 32  1  0
 32 33  2  0
 33 37  1  0
 39 29  2  0
 37 38  2  0
 38 39  1  0
 35 40  2  0
 36 35  1  0
 43 36  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 28 44  2  0
 38 45  1  0
 41 46  2  0
M  END

Alternative Forms

Associated Targets(Human)

ABCC2 Tchem Canalicular multispecific organic anion transporter 1 (1191 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Biocomponents

Calculated Properties

Molecular Weight: 651.65Molecular Weight (Monoisotopic): 651.1523AlogP: 2.08#Rotatable Bonds: 14
Polar Surface Area: 246.56Molecular Species: ZWITTERIONHBA: 10HBD: 7
#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 1.80CX Basic pKa: 9.31CX LogP: -2.23CX LogD: -9.43
Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.10Np Likeness Score: 0.38

References

1. Ryu S, Kawabe T, Nada S, Yamaguchi A..  (2000)  Identification of basic residues involved in drug export function of human multidrug resistance-associated protein 2.,  275  (1): [PMID:10978330] [10.1074/jbc.m005149200]
2. Jedlitschky, G G and 5 more authors.  1997-10-01  ATP-dependent transport of bilirubin glucuronides by the multidrug resistance protein MRP1 and its hepatocyte canalicular isoform MRP2.  [PMID:9355767]