The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Glutathione-methylfluorescein ID: ALA2074816
PubChem CID: 70697258
Max Phase: Preclinical
Molecular Formula: C31H29N3O11S
Molecular Weight: 651.65
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: Glutathione-methylfluorescein | Glutathione-methylfluorescein|CHEMBL2074816
Canonical SMILES: N[C@@H](CCC(=O)N[C@H](CSCc1ccc(-c2c3ccc(=O)cc-3oc3cc(O)ccc23)c(C(=O)O)c1)C(=O)NCC(=O)O)C(=O)O
Standard InChI: InChI=1S/C31H29N3O11S/c32-22(31(43)44)7-8-26(37)34-23(29(40)33-12-27(38)39)14-46-13-15-1-4-18(21(9-15)30(41)42)28-19-5-2-16(35)10-24(19)45-25-11-17(36)3-6-20(25)28/h1-6,9-11,22-23,35H,7-8,12-14,32H2,(H,33,40)(H,34,37)(H,38,39)(H,41,42)(H,43,44)/t22-,23+/m0/s1
Standard InChI Key: LDNATPWUBRLWGH-XZOQPEGZSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
1.7929 0.7480 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.7929 -0.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5074 -0.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5074 -1.3145 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2219 -0.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9364 -0.4895 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2219 0.7480 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6508 -0.0770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3653 -0.4895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0798 -0.0770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3653 -1.3145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7929 -1.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7929 -2.5520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0785 -1.3145 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0785 -2.9645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0785 -3.7895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2816 -4.0030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7330 -4.2917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0681 -4.7999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3018 -3.4197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0784 1.1605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0784 1.9855 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7929 2.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7929 3.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0784 3.6355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3639 3.2230 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3639 2.3980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5074 3.6355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5074 5.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2219 3.2230 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0784 5.2560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7929 5.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7929 6.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0784 6.9060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3640 6.4935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3640 5.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5074 6.9060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2219 6.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2219 5.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3505 6.9061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0650 6.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0650 5.6686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3505 5.2561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5074 4.4605 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9363 6.9061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7795 6.9061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 6
3 4 1 0
3 5 1 0
5 6 1 0
5 7 2 0
6 8 1 0
8 9 1 0
9 10 1 0
9 11 2 0
4 12 1 0
12 13 1 0
12 14 2 0
13 15 1 0
15 16 1 0
16 17 1 0
16 18 1 6
17 19 1 0
17 20 2 0
1 21 1 0
21 22 1 0
22 23 1 0
22 27 2 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
24 28 1 0
28 30 1 0
25 31 1 0
31 32 1 0
36 31 2 0
33 34 1 0
34 35 1 0
29 32 1 0
32 33 2 0
33 37 1 0
39 29 2 0
37 38 2 0
38 39 1 0
35 40 2 0
36 35 1 0
43 36 1 0
40 41 1 0
41 42 1 0
42 43 2 0
28 44 2 0
38 45 1 0
41 46 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 651.65Molecular Weight (Monoisotopic): 651.1523AlogP: 2.08#Rotatable Bonds: 14Polar Surface Area: 246.56Molecular Species: ZWITTERIONHBA: 10HBD: 7#RO5 Violations: 2HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 1.80CX Basic pKa: 9.31CX LogP: -2.23CX LogD: -9.43Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.10Np Likeness Score: 0.38
References 1. Ryu S, Kawabe T, Nada S, Yamaguchi A.. (2000) Identification of basic residues involved in drug export function of human multidrug resistance-associated protein 2., 275 (1): [PMID:10978330 ] [10.1074/jbc.m005149200 ] 2. Jedlitschky, G G and 5 more authors. 1997-10-01 ATP-dependent transport of bilirubin glucuronides by the multidrug resistance protein MRP1 and its hepatocyte canalicular isoform MRP2. [PMID:9355767 ]