The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-bromoacetyl-3,3',5-triiodothyronine ID: ALA2074819
Cas Number: 76970-94-0
PubChem CID: 122086
Max Phase: Preclinical
Molecular Formula: C17H13BrI3NO5
Molecular Weight: 771.91
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CBr)N[C@@H](Cc1cc(I)c(Oc2ccc(O)c(I)c2)c(I)c1)C(=O)O
Standard InChI: InChI=1S/C17H13BrI3NO5/c18-7-15(24)22-13(17(25)26)5-8-3-11(20)16(12(21)4-8)27-9-1-2-14(23)10(19)6-9/h1-4,6,13,23H,5,7H2,(H,22,24)(H,25,26)/t13-/m0/s1
Standard InChI Key: AGUVIBCJWRFUTQ-ZDUSSCGKSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
2.5339 8.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8194 7.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8194 6.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5339 6.4527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2484 6.8652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2484 7.6902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9629 8.1027 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9629 6.4527 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
1.1050 6.4527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1050 5.6277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3905 5.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3905 4.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1050 3.9777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8195 4.3902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8195 5.2152 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5339 5.6277 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
-0.3240 5.6277 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
1.1050 3.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3905 2.7402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3905 1.9152 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.3240 3.1527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0385 2.7402 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3240 3.9777 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3240 1.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3240 0.6777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0385 1.9152 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0385 0.2652 0.0000 Br 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 2 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 1 0
5 8 1 0
3 9 1 0
9 10 1 0
10 11 1 0
10 15 2 0
11 12 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 1 0
11 17 1 0
13 18 1 0
18 19 1 0
19 20 1 6
19 21 1 0
21 22 1 0
21 23 2 0
20 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 771.91Molecular Weight (Monoisotopic): 770.7111AlogP: 4.51#Rotatable Bonds: 7Polar Surface Area: 95.86Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 1.88CX Basic pKa: ┄CX LogP: 5.60CX LogD: 2.05Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.29Np Likeness Score: 0.22
References 1. Friesema EC, Ganguly S, Abdalla A, Manning Fox JE, Halestrap AP, Visser TJ.. (2003) Identification of monocarboxylate transporter 8 as a specific thyroid hormone transporter., 278 (1): [PMID:12871948 ] [10.1074/jbc.m300909200 ]