NB-506

ID: ALA2074831

Cas Number: 151069-12-4

PubChem CID: 9915861

Max Phase: Preclinical

Molecular Formula: C27H22N4O10

Molecular Weight: 562.49

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=CNN1C(=O)c2c(c3c4cccc(O)c4n([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c3c3[nH]c4c(O)cccc4c23)C1=O

Standard InChI:  InChI=1S/C27H22N4O10/c32-7-13-22(36)23(37)24(38)27(41-13)30-20-10(4-2-6-12(20)35)15-17-16(25(39)31(26(17)40)28-8-33)14-9-3-1-5-11(34)18(9)29-19(14)21(15)30/h1-6,8,13,22-24,27,29,32,34-38H,7H2,(H,28,33)/t13-,22-,23+,24-,27-/m1/s1

Standard InChI Key:  WHTCLLAVOBBKHK-ISCYQWKGSA-N

Molfile:  

     RDKit          2D

 41 47  0  0  0  0  0  0  0  0999 V2000
    1.8268    5.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4143    6.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5893    6.6663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1768    5.9518    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5893    5.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4143    5.2373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3344    7.4508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0018    7.9358    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6692    7.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0018    8.7608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7162    9.1733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4307    8.7608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4538    7.7058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4503    7.7058    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0373    4.6242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7164    4.9598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6302    5.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9663    4.6242    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7200    4.9598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6338    5.7802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2977    6.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0513    5.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1375    5.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4701    4.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3012    6.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0549    5.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1411    5.1091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4736    4.6242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5563    3.8037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5599    3.8037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6261    2.9759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0884    3.3884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8029    2.9759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8029    2.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0884    1.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6261    2.1509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5174    1.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5174    0.9134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0884    0.9134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3406    1.7384    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3406    3.3884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  3  4  2  0
  5  6  2  0
  2  9  1  0
  2  3  1  0
  3  7  1  0
  7  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
  9 13  2  0
  7 14  2  0
  5 15  1  0
  4  5  1  0
  4 17  1  0
 15 16  1  0
  6 18  1  0
  1  6  1  0
  1 20  1  0
 18 19  1  0
 24 16  1  0
 16 17  2  0
 17 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 28 19  2  0
 19 20  1  0
 20 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 24 29  1  0
 28 30  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 36 31  1  0
 32 15  1  1
 34 37  1  1
 37 38  1  0
 35 39  1  6
 36 40  1  1
 31 41  1  6
M  END

Alternative Forms

  1. Parent:

    ALA2074831

    Unii-Q7SF8H5TF6

Associated Targets(non-human)

Abcg2 ATP-binding cassette sub-family G member 2 (64 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 562.49Molecular Weight (Monoisotopic): 562.1336AlogP: 0.07#Rotatable Bonds: 4
Polar Surface Area: 217.81Molecular Species: NEUTRALHBA: 11HBD: 8
#RO5 Violations: 3HBA (Lipinski): 14HBD (Lipinski): 8#RO5 Violations (Lipinski): 3
CX Acidic pKa: 9.01CX Basic pKa: CX LogP: -0.51CX LogD: -0.52
Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.11Np Likeness Score: 1.02

References

1. Komatani H, Kotani H, Hara Y, Nakagawa R, Matsumoto M, Arakawa H, Nishimura S..  (2001)  Identification of breast cancer resistant protein/mitoxantrone resistance/placenta-specific, ATP-binding cassette transporter as a transporter of NB-506 and J-107088, topoisomerase I inhibitors with an indolocarbazole structure.,  61  (1): [PMID:11306452]